DB00396 Progesterone

InChI Key: RJKFOVLPORLFTN-LEKSSAKUSA-N
SMILES: [H][C@@]12CC[C@H](C(C)=O)[C@@]1(C)CC[C@@]1([H])[C@@]2([H])CCC2=CC(=O)CC[C@]12C
Small molecule PDB accession : STR

List of proteins that are targets for DB00396
# DrugDomain Data UniProt Accession Drug action Protein name Affinity data
1 P41145_DB00396 P41145 activator Kappa-type opioid receptor
2 P05093_DB00396 P05093 substrate Steroid 17-alpha-hydroxylase/17,20 lyase
3 P02763_DB00396 P02763 binder Alpha-1-acid glycoprotein 1
4 P08235_DB00396 P08235 antagonist Mineralocorticoid receptor IC50(nM) = 14.0
Kd(nM) = 0.39
5 P04150_DB00396 P04150 partial agonist Glucocorticoid receptor Ki(nM) = 30.5
IC50(nM) = 1000.0
6 Q92731_DB00396 Q92731 agonist Estrogen receptor beta
7 P10275_DB00396 P10275 agonist Androgen receptor Ki(nM) = 8.5
IC50(nM) = 14.0
8 P04278_DB00396 P04278 binder Sex hormone-binding globulin Kd(nM) = 115.0
9 P03372_DB00396 P03372 agonist Estrogen receptor IC50(nM) = 1000.0
10 P06401_DB00396 P06401 agonist Progesterone receptor Ki(nM) = 3.4
IC50(nM) = 0.2
EC50(nM) = 0.1