DB00396 Progesterone
InChI Key: RJKFOVLPORLFTN-LEKSSAKUSA-N
SMILES: [H][C@@]12CC[C@H](C(C)=O)[C@@]1(C)CC[C@@]1([H])[C@@]2([H])CCC2=CC(=O)CC[C@]12C
Small molecule PDB accession : STR
List of proteins that are targets for DB00396
| # | DrugDomain Data | UniProt Accession | Drug action | Protein name | Affinity data |
|---|---|---|---|---|---|
| 1 | P41145_DB00396 | P41145 | activator | Kappa-type opioid receptor | |
| 2 | P05093_DB00396 | P05093 | substrate | Steroid 17-alpha-hydroxylase/17,20 lyase | |
| 3 | P02763_DB00396 | P02763 | binder | Alpha-1-acid glycoprotein 1 | |
| 4 | P08235_DB00396 | P08235 | antagonist | Mineralocorticoid receptor | IC50(nM) = 14.0 Kd(nM) = 0.39 |
| 5 | P04150_DB00396 | P04150 | partial agonist | Glucocorticoid receptor | Ki(nM) = 30.5 IC50(nM) = 1000.0 |
| 6 | Q92731_DB00396 | Q92731 | agonist | Estrogen receptor beta | |
| 7 | P10275_DB00396 | P10275 | agonist | Androgen receptor | Ki(nM) = 8.5 IC50(nM) = 14.0 |
| 8 | P04278_DB00396 | P04278 | binder | Sex hormone-binding globulin | Kd(nM) = 115.0 |
| 9 | P03372_DB00396 | P03372 | agonist | Estrogen receptor | IC50(nM) = 1000.0 |
| 10 | P06401_DB00396 | P06401 | agonist | Progesterone receptor | Ki(nM) = 3.4 IC50(nM) = 0.2 EC50(nM) = 0.1 |