DB00398 Sorafenib
InChI Key: MLDQJTXFUGDVEO-UHFFFAOYSA-N
SMILES: CNC(=O)C1=NC=CC(OC2=CC=C(NC(=O)NC3=CC(=C(Cl)C=C3)C(F)(F)F)C=C2)=C1
Small molecule PDB accession : BAX
List of proteins that are targets for DB00398
# | DrugDomain Data | UniProt Accession | Drug action | Protein name | Affinity data |
---|---|---|---|---|---|
1 | P35916_DB00398 | P35916 | antagonist | Vascular endothelial growth factor receptor 3 | IC50(nM) = 3.0 Kd(nM) = 16.0 |
2 | P07949_DB00398 | P07949 | inhibitor | Proto-oncogene tyrosine-protein kinase receptor Ret | IC50(nM) = 5.9 Kd(nM) = 7.4 |
3 | P35968_DB00398 | P35968 | antagonist | Vascular endothelial growth factor receptor 2 | Ki(nM) = 0.021 IC50(nM) = 0.06 Kd(nM) = 33.0 EC50(nM) = 500.0 |
4 | P15056_DB00398 | P15056 | inhibitor | Serine/threonine-protein kinase B-raf | Ki(nM) = 22.0 IC50(nM) = 4.4 Kd(nM) = 260.0 EC50(nM) = 3.0 |
5 | P36888_DB00398 | P36888 | antagonist | Receptor-type tyrosine-protein kinase FLT3 | IC50(nM) = 1.3 Kd(nM) = 4.5 |
6 | P10721_DB00398 | P10721 | antagonist | Mast/stem cell growth factor receptor Kit | Ki(nM) = 16000.0 IC50(nM) = 31.0 Kd(nM) = 16.0 |
7 | P09619_DB00398 | P09619 | antagonist | Platelet-derived growth factor receptor beta | IC50(nM) = 0.26 Kd(nM) = 37.0 |
8 | P17948_DB00398 | P17948 | inhibitor | Vascular endothelial growth factor receptor 1 | IC50(nM) = 18.0 Kd(nM) = 31.0 |
9 | P04049_DB00398 | P04049 | inhibitor | RAF proto-oncogene serine/threonine-protein kinase | IC50(nM) = 1.0 Kd(nM) = 230.0 |
10 | P11362_DB00398 | P11362 | inhibitor | Fibroblast growth factor receptor 1 | IC50(nM) = 4.6 Kd(nM) = 2500.0 |