DB00398 Sorafenib

InChI Key: MLDQJTXFUGDVEO-UHFFFAOYSA-N
SMILES: CNC(=O)C1=NC=CC(OC2=CC=C(NC(=O)NC3=CC(=C(Cl)C=C3)C(F)(F)F)C=C2)=C1
Small molecule PDB accession : BAX

List of proteins that are targets for DB00398
# DrugDomain Data UniProt Accession Drug action Protein name Affinity data
1 P35916_DB00398 P35916 antagonist Vascular endothelial growth factor receptor 3 IC50(nM) = 3.0
Kd(nM) = 16.0
2 P07949_DB00398 P07949 inhibitor Proto-oncogene tyrosine-protein kinase receptor Ret IC50(nM) = 5.9
Kd(nM) = 7.4
3 P35968_DB00398 P35968 antagonist Vascular endothelial growth factor receptor 2 Ki(nM) = 0.021
IC50(nM) = 0.06
Kd(nM) = 33.0
EC50(nM) = 500.0
4 P15056_DB00398 P15056 inhibitor Serine/threonine-protein kinase B-raf Ki(nM) = 22.0
IC50(nM) = 4.4
Kd(nM) = 260.0
EC50(nM) = 3.0
5 P36888_DB00398 P36888 antagonist Receptor-type tyrosine-protein kinase FLT3 IC50(nM) = 1.3
Kd(nM) = 4.5
6 P10721_DB00398 P10721 antagonist Mast/stem cell growth factor receptor Kit Ki(nM) = 16000.0
IC50(nM) = 31.0
Kd(nM) = 16.0
7 P09619_DB00398 P09619 antagonist Platelet-derived growth factor receptor beta IC50(nM) = 0.26
Kd(nM) = 37.0
8 P17948_DB00398 P17948 inhibitor Vascular endothelial growth factor receptor 1 IC50(nM) = 18.0
Kd(nM) = 31.0
9 P04049_DB00398 P04049 inhibitor RAF proto-oncogene serine/threonine-protein kinase IC50(nM) = 1.0
Kd(nM) = 230.0
10 P11362_DB00398 P11362 inhibitor Fibroblast growth factor receptor 1 IC50(nM) = 4.6
Kd(nM) = 2500.0