DB00451 Levothyroxine
InChI Key: XUIIKFGFIJCVMT-LBPRGKRZSA-N
SMILES: N[C@@H](CC1=CC(I)=C(OC2=CC(I)=C(O)C(I)=C2)C(I)=C1)C(O)=O
Small molecule PDB accession : T44
List of proteins that are targets for DB00451
# | DrugDomain Data | UniProt Accession | Drug action | Protein name | Affinity data |
---|---|---|---|---|---|
1 | P10827_DB00451 | P10827 | agonist | Thyroid hormone receptor alpha | EC50(nM) = 19.0 |
2 | P06756_DB00451 | P06756 | n/a | Integrin alpha-V | |
3 | P05106_DB00451 | P05106 | n/a | Integrin beta-3 | |
4 | P10828_DB00451 | P10828 | agonist | Thyroid hormone receptor beta | EC50(nM) = 240.0 |