DB00458 Imipramine
InChI Key: BCGWQEUPMDMJNV-UHFFFAOYSA-N
SMILES: CN(C)CCCN1C2=CC=CC=C2CCC2=CC=CC=C12
Small molecule PDB accession : IXX
List of proteins that are targets for DB00458
# | DrugDomain Data | UniProt Accession | Drug action | Protein name | Affinity data |
---|---|---|---|---|---|
1 | P34969_DB00458 | P34969 | antagonist | 5-hydroxytryptamine receptor 7 | Ki(nM) = 1000.0 |
2 | P50406_DB00458 | P50406 | binder | 5-hydroxytryptamine receptor 6 | Ki(nM) = 190.0 |
3 | Q9NZV8_DB00458 | Q9NZV8 | inhibitor | Potassium voltage-gated channel subfamily D member 2 | |
4 | P08908_DB00458 | P08908 | activator | 5-hydroxytryptamine receptor 1A | Ki(nM) = 5800.0 |
5 | P08912_DB00458 | P08912 | antagonist | Muscarinic acetylcholine receptor M5 | Ki(nM) = 83.0 |
6 | P28335_DB00458 | P28335 | antagonist | 5-hydroxytryptamine receptor 2C | Ki(nM) = 150.0 |
7 | P28223_DB00458 | P28223 | antagonist | 5-hydroxytryptamine receptor 2A | Ki(nM) = 94.0 |
8 | O95259_DB00458 | O95259 | n/a | Potassium voltage-gated channel subfamily H member 1 | |
9 | P31645_DB00458 | P31645 | inhibitor | Sodium-dependent serotonin transporter | Ki(nM) = 0.15 IC50(nM) = 0.88 |
10 | P08173_DB00458 | P08173 | antagonist | Muscarinic acetylcholine receptor M4 | Ki(nM) = 112.0 |
11 | P11229_DB00458 | P11229 | antagonist | Muscarinic acetylcholine receptor M1 | Ki(nM) = 42.0 |
12 | P14416_DB00458 | P14416 | binder | D | Ki(nM) = 620.0 IC50(nM) = 410.0 |
13 | P08172_DB00458 | P08172 | antagonist | Muscarinic acetylcholine receptor M2 | Ki(nM) = 0.13 |
14 | P35367_DB00458 | P35367 | antagonist | Histamine H1 receptor | Ki(nM) = 10.0 IC50(nM) = 27.0 |
15 | P19652_DB00458 | P19652 | n/a | Alpha-1-acid glycoprotein 2 | |
16 | P20309_DB00458 | P20309 | antagonist | Muscarinic acetylcholine receptor M3 | Ki(nM) = 60.0 |
17 | Q9UK17_DB00458 | Q9UK17 | inhibitor | Potassium voltage-gated channel subfamily D member 3 | |
18 | Q12809_DB00458 | Q12809 | inhibitor | Potassium voltage-gated channel subfamily H member 2 | IC50(nM) = 3388.0 |
19 | P23975_DB00458 | P23975 | inhibitor | Sodium-dependent noradrenaline transporter | Ki(nM) = 16.0 IC50(nM) = 74.0 |
20 | P35368_DB00458 | P35368 | antagonist | Alpha-1B adrenergic receptor | |
21 | Q01959_DB00458 | Q01959 | inhibitor | Sodium-dependent dopamine transporter | Ki(nM) = 8500.0 IC50(nM) = 25600.0 |
22 | P35348_DB00458 | P35348 | antagonist | Alpha-1A adrenergic receptor | Ki(nM) = 32.0 |
23 | P25100_DB00458 | P25100 | antagonist | Alpha-1D adrenergic receptor |