DB00466 Picrotoxin
InChI Key: VJKUPQSHOVKBCO-ZTYBEOBUSA-N
SMILES: [H][C@@]12OC(=O)[C@@]34OC3C[C@@](O)(C3[C@@H](C1OC3=O)C(C)=C)[C@@]24C.[H][C@@]12C[C@@]3(O)C4[C@@H](C(OC4=O)[C@@]4([H])OC(=O)[C@]1(O2)[C@@]34C)C(C)(C)O
Small molecule PDB accession : n/a
List of proteins that are targets for DB00466
| # | DrugDomain Data | UniProt Accession | Drug action | Protein name | Affinity data |
|---|---|---|---|---|---|
| 1 | P14867_DB00466 | P14867 | antagonist | Gamma-aminobutyric acid receptor subunit alpha-1 | |
| 2 | O75311_DB00466 | O75311 | antagonist | Glycine receptor subunit alpha-3 | |
| 3 | P23416_DB00466 | P23416 | antagonist | Glycine receptor subunit alpha-2 | |
| 4 | P23415_DB00466 | P23415 | antagonist | Glycine receptor subunit alpha-1 | |
| 5 | P24046_DB00466 | P24046 | antagonist | Gamma-aminobutyric acid receptor subunit rho-1 |