DB00472 Fluoxetine
InChI Key: RTHCYVBBDHJXIQ-UHFFFAOYSA-N
SMILES: CNCCC(OC1=CC=C(C=C1)C(F)(F)F)C1=CC=CC=C1
Small molecule PDB accession : n/a
List of proteins that are targets for DB00472
# | DrugDomain Data | UniProt Accession | Drug action | Protein name | Affinity data |
---|---|---|---|---|---|
1 | P30926_DB00472 | P30926 | antagonist | Neuronal acetylcholine receptor subunit beta-4 | |
2 | P28335_DB00472 | P28335 | antagonist | 5-hydroxytryptamine receptor 2C | Ki(nM) = 72.0 IC50(nM) = 160.0 |
3 | P31645_DB00472 | P31645 | inhibitor | Sodium-dependent serotonin transporter | Ki(nM) = 0.72 IC50(nM) = 2.5 Kd(nM) = 0.81 EC50(nM) = 2.7 |
4 | Q15822_DB00472 | Q15822 | antagonist | Neuronal acetylcholine receptor subunit alpha-2 | |
5 | P32297_DB00472 | P32297 | antagonist | Neuronal acetylcholine receptor subunit alpha-3 | |
6 | Q12809_DB00472 | Q12809 | inhibitor | Potassium voltage-gated channel subfamily H member 2 | IC50(nM) = 457.09 |
7 | P61024_DB00472 | P61024 | n/a | Cyclin-dependent kinases regulatory subunit 1 |