DB00477 Chlorpromazine
InChI Key: ZPEIMTDSQAKGNT-UHFFFAOYSA-N
SMILES: CN(C)CCCN1C2=CC=CC=C2SC2=C1C=C(Cl)C=C2
Small molecule PDB accession : Z80
List of proteins that are targets for DB00477
# | DrugDomain Data | UniProt Accession | Drug action | Protein name | Affinity data |
---|---|---|---|---|---|
1 | P21918_DB00477 | P21918 | inhibitor | D | Ki(nM) = 133.0 |
2 | P34969_DB00477 | P34969 | binder | 5-hydroxytryptamine receptor 7 | Ki(nM) = 11.0 |
3 | P50406_DB00477 | P50406 | binder | 5-hydroxytryptamine receptor 6 | Ki(nM) = 4.0 |
4 | P08908_DB00477 | P08908 | antagonist | 5-hydroxytryptamine receptor 1A | Ki(nM) = 116.4 |
5 | P21728_DB00477 | P21728 | antagonist | D | Ki(nM) = 44.0 |
6 | P28335_DB00477 | P28335 | binder | 5-hydroxytryptamine receptor 2C | Ki(nM) = 1.4 |
7 | P28223_DB00477 | P28223 | antagonist | 5-hydroxytryptamine receptor 2A | Ki(nM) = 1.8 |
8 | P21917_DB00477 | P21917 | binder | D | Ki(nM) = 1.15 |
9 | P17405_DB00477 | P17405 | inhibitor | Sphingomyelin phosphodiesterase | IC50(nM) = 11000.0 |
10 | P11229_DB00477 | P11229 | antagonist | Muscarinic acetylcholine receptor M1 | Ki(nM) = 25.0 |
11 | P14416_DB00477 | P14416 | antagonist | D | Ki(nM) = 0.66 IC50(nM) = 1.0 |
12 | P35367_DB00477 | P35367 | antagonist | Histamine H1 receptor | Ki(nM) = 3.0 IC50(nM) = 12.0 |
13 | P35462_DB00477 | P35462 | inhibitor | D | Ki(nM) = 0.84 |
14 | P20309_DB00477 | P20309 | antagonist | Muscarinic acetylcholine receptor M3 | Ki(nM) = 47.0 |
15 | P0DP23_DB00477 | P0DP23 | inhibitor | Calmodulin-1 | Ki(nM) = 19280.0 IC50(nM) = 7260.0 |
16 | Q12809_DB00477 | Q12809 | inhibitor | Potassium voltage-gated channel subfamily H member 2 | IC50(nM) = 1470.0 |
17 | P35368_DB00477 | P35368 | antagonist | Alpha-1B adrenergic receptor | |
18 | P35348_DB00477 | P35348 | antagonist | Alpha-1A adrenergic receptor | Ki(nM) = 0.28 |
19 | Q9H3N8_DB00477 | Q9H3N8 | binder | Histamine H4 receptor | Ki(nM) = 50.2 |