DB00482 Celecoxib
InChI Key: RZEKVGVHFLEQIL-UHFFFAOYSA-N
SMILES: CC1=CC=C(C=C1)C1=CC(=NN1C1=CC=C(C=C1)S(N)(=O)=O)C(F)(F)F
Small molecule PDB accession : CEL
List of proteins that are targets for DB00482
# | DrugDomain Data | UniProt Accession | Drug action | Protein name | Affinity data |
---|---|---|---|---|---|
1 | P35354_DB00482 | P35354 | inhibitor | Prostaglandin G/H synthase 2 | Ki(nM) = 0.47 IC50(nM) = 0.52 Kd(nM) = 789.09 |
2 | P07451_DB00482 | P07451 | inhibitor | Carbonic anhydrase 3 | Ki(nM) = 7400.0 |
3 | O15530_DB00482 | O15530 | inhibitor | 3-phosphoinositide-dependent protein kinase 1 | IC50(nM) = 48000.0 |
4 | P00918_DB00482 | P00918 | inhibitor | Carbonic anhydrase 2 | Ki(nM) = 21.0 IC50(nM) = 21.0 |
5 | Q99519_DB00482 | Q99519 | inhibitor | Sialidase-1 |