DB00502 Haloperidol

InChI Key: LNEPOXFFQSENCJ-UHFFFAOYSA-N
SMILES: OC1(CCN(CCCC(=O)C2=CC=C(F)C=C2)CC1)C1=CC=C(Cl)C=C1
Small molecule PDB accession : GMJ

List of proteins that are targets for DB00502
# DrugDomain Data UniProt Accession Drug action Protein name Affinity data
1 P34969_DB00502 P34969 n/a 5-hydroxytryptamine receptor 7 Ki(nM) = 316.0
2 P50406_DB00502 P50406 n/a 5-hydroxytryptamine receptor 6 Ki(nM) = 1083.0
3 P08908_DB00502 P08908 n/a 5-hydroxytryptamine receptor 1A Ki(nM) = 1202.0
IC50(nM) = 1500.0
4 P21728_DB00502 P21728 antagonist D Ki(nM) = 6.17
5 P18825_DB00502 P18825 n/a Alpha-2C adrenergic receptor Ki(nM) = 550.0
6 P18089_DB00502 P18089 n/a Alpha-2B adrenergic receptor Ki(nM) = 480.0
7 P28335_DB00502 P28335 n/a 5-hydroxytryptamine receptor 2C Ki(nM) = 35.71
IC50(nM) = 10000.0
8 P28223_DB00502 P28223 other/unknown 5-hydroxytryptamine receptor 2A Ki(nM) = 20.0
IC50(nM) = 288.0
9 Q99720_DB00502 Q99720 n/a Sigma non-opioid intracellular receptor 1 Ki(nM) = 0.2
IC50(nM) = 2.1
10 Q13224_DB00502 Q13224 antagonist Glutamate receptor ionotropic, NMDA 2B
11 P14416_DB00502 P14416 antagonist D Ki(nM) = 0.12
IC50(nM) = 0.16
Kd(nM) = 0.489779
12 P35367_DB00502 P35367 n/a Histamine H1 receptor Ki(nM) = 260.0
13 P35462_DB00502 P35462 inverse agonist D Ki(nM) = 0.2
IC50(nM) = 0.06
14 P20309_DB00502 P20309 n/a Muscarinic acetylcholine receptor M3 Ki(nM) = 4670.0
15 P08913_DB00502 P08913 n/a Alpha-2A adrenergic receptor Ki(nM) = 600.0
16 P35348_DB00502 P35348 n/a Alpha-1A adrenergic receptor Ki(nM) = 6.1
17 Q05940_DB00502 Q05940 n/a Synaptic vesicular amine transporter
18 Q99705_DB00502 Q99705 n/a Melanin-concentrating hormone receptor 1