DB00523 Alitretinoin

InChI Key: SHGAZHPCJJPHSC-ZVCIMWCZSA-N
SMILES: C\C(\C=C\C1=C(C)CCCC1(C)C)=C\C=C\C(\C)=C\C(O)=O
Small molecule PDB accession : 9CR

List of proteins that are targets for DB00523
# DrugDomain Data UniProt Accession Drug action Protein name Affinity data
1 P17936_DB00523 P17936 n/a Insulin-like growth factor-binding protein 3
2 P48443_DB00523 P48443 agonist Retinoic acid receptor RXR-gamma Ki(nM) = 11.0
IC50(nM) = 4.0
Kd(nM) = 14.0
EC50(nM) = 4.3
3 P10826_DB00523 P10826 agonist Retinoic acid receptor beta Ki(nM) = 0.5
IC50(nM) = 7.0
Kd(nM) = 0.2
EC50(nM) = 0.8
4 P28702_DB00523 P28702 agonist Retinoic acid receptor RXR-beta Ki(nM) = 3.8
IC50(nM) = 12.0
Kd(nM) = 11.0
EC50(nM) = 2.6
5 P13631_DB00523 P13631 agonist Retinoic acid receptor gamma Ki(nM) = 1.0
IC50(nM) = 17.0
Kd(nM) = 0.8
EC50(nM) = 4.0
6 P10276_DB00523 P10276 agonist Retinoic acid receptor alpha Ki(nM) = 22.0
IC50(nM) = 7.0
Kd(nM) = 0.3
EC50(nM) = 1.0
7 P19793_DB00523 P19793 agonist Retinoic acid receptor RXR-alpha Ki(nM) = 8.0
IC50(nM) = 29.0
Kd(nM) = 1.5
EC50(nM) = 1.5
8 Q6V0L0_DB00523 Q6V0L0 n/a Cytochrome P450 26C1
9 Q15238_DB00523 Q15238 n/a Pregnancy-specific beta-1-glycoprotein 5