DB00523 Alitretinoin
InChI Key: SHGAZHPCJJPHSC-ZVCIMWCZSA-N
SMILES: C\C(\C=C\C1=C(C)CCCC1(C)C)=C\C=C\C(\C)=C\C(O)=O
Small molecule PDB accession : 9CR
List of proteins that are targets for DB00523
# | DrugDomain Data | UniProt Accession | Drug action | Protein name | Affinity data |
---|---|---|---|---|---|
1 | P17936_DB00523 | P17936 | n/a | Insulin-like growth factor-binding protein 3 | |
2 | P48443_DB00523 | P48443 | agonist | Retinoic acid receptor RXR-gamma | Ki(nM) = 11.0 IC50(nM) = 4.0 Kd(nM) = 14.0 EC50(nM) = 4.3 |
3 | P10826_DB00523 | P10826 | agonist | Retinoic acid receptor beta | Ki(nM) = 0.5 IC50(nM) = 7.0 Kd(nM) = 0.2 EC50(nM) = 0.8 |
4 | P28702_DB00523 | P28702 | agonist | Retinoic acid receptor RXR-beta | Ki(nM) = 3.8 IC50(nM) = 12.0 Kd(nM) = 11.0 EC50(nM) = 2.6 |
5 | P13631_DB00523 | P13631 | agonist | Retinoic acid receptor gamma | Ki(nM) = 1.0 IC50(nM) = 17.0 Kd(nM) = 0.8 EC50(nM) = 4.0 |
6 | P10276_DB00523 | P10276 | agonist | Retinoic acid receptor alpha | Ki(nM) = 22.0 IC50(nM) = 7.0 Kd(nM) = 0.3 EC50(nM) = 1.0 |
7 | P19793_DB00523 | P19793 | agonist | Retinoic acid receptor RXR-alpha | Ki(nM) = 8.0 IC50(nM) = 29.0 Kd(nM) = 1.5 EC50(nM) = 1.5 |
8 | Q6V0L0_DB00523 | Q6V0L0 | n/a | Cytochrome P450 26C1 | |
9 | Q15238_DB00523 | Q15238 | n/a | Pregnancy-specific beta-1-glycoprotein 5 |