DB00543 Amoxapine
InChI Key: QWGDMFLQWFTERH-UHFFFAOYSA-N
SMILES: ClC1=CC2=C(OC3=CC=CC=C3N=C2N2CCNCC2)C=C1
Small molecule PDB accession : n/a
List of proteins that are targets for DB00543
# | DrugDomain Data | UniProt Accession | Drug action | Protein name | Affinity data |
---|---|---|---|---|---|
1 | P34969_DB00543 | P34969 | antagonist | 5-hydroxytryptamine receptor 7 | Ki(nM) = 500.0 |
2 | P50406_DB00543 | P50406 | antagonist | 5-hydroxytryptamine receptor 6 | Ki(nM) = 50.0 |
3 | P08908_DB00543 | P08908 | antagonist | 5-hydroxytryptamine receptor 1A | Ki(nM) = 221.0 |
4 | P21728_DB00543 | P21728 | antagonist | D | |
5 | P14867_DB00543 | P14867 | antagonist | Gamma-aminobutyric acid receptor subunit alpha-1 | |
6 | P28335_DB00543 | P28335 | antagonist | 5-hydroxytryptamine receptor 2C | |
7 | P28223_DB00543 | P28223 | antagonist | 5-hydroxytryptamine receptor 2A | Ki(nM) = 1.77 |
8 | P21917_DB00543 | P21917 | antagonist | D | Ki(nM) = 2.0 |
9 | P31645_DB00543 | P31645 | inhibitor | Sodium-dependent serotonin transporter | Ki(nM) = 58.0 |
10 | P11229_DB00543 | P11229 | antagonist | Muscarinic acetylcholine receptor M1 | |
11 | P14416_DB00543 | P14416 | antagonist | D | Ki(nM) = 3.6 |
12 | P41595_DB00543 | P41595 | antagonist | 5-hydroxytryptamine receptor 2B | |
13 | P28222_DB00543 | P28222 | antagonist | 5-hydroxytryptamine receptor 1B | |
14 | P35367_DB00543 | P35367 | antagonist | Histamine H1 receptor | |
15 | P35462_DB00543 | P35462 | antagonist | D | Ki(nM) = 11.0 |
16 | P08913_DB00543 | P08913 | antagonist | Alpha-2A adrenergic receptor | |
17 | P23975_DB00543 | P23975 | inhibitor | Sodium-dependent noradrenaline transporter | Ki(nM) = 16.0 |
18 | Q01959_DB00543 | Q01959 | binder | Sodium-dependent dopamine transporter | Ki(nM) = 4310.0 |
19 | P35348_DB00543 | P35348 | antagonist | Alpha-1A adrenergic receptor | |
20 | P46098_DB00543 | P46098 | antagonist | 5-hydroxytryptamine receptor 3A | |
21 | Q9H3N8_DB00543 | Q9H3N8 | binder | Histamine H4 receptor | Ki(nM) = 5012.0 |