DrugDomain - DB00563

DB00563 Methotrexate

InChI Key: FBOZXECLQNJBKD-ZDUSSCGKSA-N
SMILES: CN(CC1=CN=C2N=C(N)N=C(N)C2=N1)C1=CC=C(C=C1)C(=O)N[C@@H](CCC(O)=O)C(O)=O
Small molecule PDB accession : MTX

List of proteins that are targets for DB00563

# DrugDomain Data UniProt Accession Drug action Protein name Affinity data

1 P31939_DB00563 P31939 inhibitor Bifunctional purine biosynthesis protein ATIC Ki(nM) = 880.0
IC50(nM) = 20000.0

2 P04818_DB00563 P04818 inhibitor Thymidylate synthase Ki(nM) = 600.0
IC50(nM) = 10.0

3 P00374_DB00563 P00374 inhibitor Dihydrofolate reductase Ki(nM) = 3.4E-4
IC50(nM) = 0.7
Kd(nM) = 0.194984
EC50(nM) = 12.5

#	DrugDomain Data	UniProt Accession	Drug action	Protein name	Affinity data
1	P31939_DB00563	P31939	inhibitor	Bifunctional purine biosynthesis protein ATIC	Ki(nM) = 880.0 IC50(nM) = 20000.0
2	P04818_DB00563	P04818	inhibitor	Thymidylate synthase	Ki(nM) = 600.0 IC50(nM) = 10.0
3	P00374_DB00563	P00374	inhibitor	Dihydrofolate reductase	Ki(nM) = 3.4E-4 IC50(nM) = 0.7 Kd(nM) = 0.194984 EC50(nM) = 12.5