DB00568 Cinnarizine
InChI Key: DERZBLKQOCDDDZ-JLHYYAGUSA-N
SMILES: C(\C=C\C1=CC=CC=C1)N1CCN(CC1)C(C1=CC=CC=C1)C1=CC=CC=C1
Small molecule PDB accession : N90
List of proteins that are targets for DB00568
| # | DrugDomain Data | UniProt Accession | Drug action | Protein name | Affinity data |
|---|---|---|---|---|---|
| 1 | Q9P0X4_DB00568 | Q9P0X4 | inhibitor | Voltage-dependent T-type calcium channel subunit alpha-1I | |
| 2 | O43497_DB00568 | O43497 | inhibitor | Voltage-dependent T-type calcium channel subunit alpha-1G | |
| 3 | P14416_DB00568 | P14416 | other/unknown | D | |
| 4 | P35367_DB00568 | P35367 | antagonist | Histamine H1 receptor | |
| 5 | Q01668_DB00568 | Q01668 | inhibitor | Voltage-dependent L-type calcium channel subunit alpha-1D | |
| 6 | Q13698_DB00568 | Q13698 | inhibitor | Voltage-dependent L-type calcium channel subunit alpha-1S | |
| 7 | Q13936_DB00568 | Q13936 | inhibitor | Voltage-dependent L-type calcium channel subunit alpha-1C | |
| 8 | O95180_DB00568 | O95180 | inhibitor | Voltage-dependent T-type calcium channel subunit alpha-1H | |
| 9 | O60840_DB00568 | O60840 | inhibitor | Voltage-dependent L-type calcium channel subunit alpha-1F |