DB00570 Vinblastine
InChI Key: JXLYSJRDGCGARV-CFWMRBGOSA-N
SMILES: [H][C@@]12N(C)C3=CC(OC)=C(C=C3[C@@]11CCN3CC=C[C@@](CC)([C@@H](OC(C)=O)[C@]2(O)C(=O)OC)[C@@]13[H])[C@]1(C[C@@]2([H])CN(C[C@](O)(CC)C2)CCC2=C1NC1=C2C=CC=C1)C(=O)OC
Small molecule PDB accession : VLB
List of proteins that are targets for DB00570
| # | DrugDomain Data | UniProt Accession | Drug action | Protein name | Affinity data |
|---|---|---|---|---|---|
| 1 | Q71U36_DB00570 | Q71U36 | binder | Tubulin alpha-1A chain | |
| 2 | P07437_DB00570 | P07437 | binder | Tubulin beta chain | |
| 3 | P23258_DB00570 | P23258 | binder | Tubulin gamma-1 chain | |
| 4 | P05412_DB00570 | P05412 | other/unknown | Transcription factor AP-1 | |
| 5 | Q9UJT1_DB00570 | Q9UJT1 | binder | Tubulin delta chain | |
| 6 | Q9UJT0_DB00570 | Q9UJT0 | binder | Tubulin epsilon chain |