DrugDomain - DB00571

DB00571 Propranolol

InChI Key: AQHHHDLHHXJYJD-UHFFFAOYSA-N
SMILES: CC(C)NCC(O)COC1=CC=CC2=C1C=CC=C2
Small molecule PDB accession : n/a

List of proteins that are targets for DB00571

# DrugDomain Data UniProt Accession Drug action Protein name Affinity data

1 P08908_DB00571 P08908 other/unknown 5-hydroxytryptamine receptor 1A Ki(nM) = 31.0
IC50(nM) = 3981.0

2 P28222_DB00571 P28222 other/unknown 5-hydroxytryptamine receptor 1B Ki(nM) = 56.23
IC50(nM) = 5012.0
EC50(nM) = 5012.0

3 P08588_DB00571 P08588 antagonist Beta-1 adrenergic receptor Ki(nM) = 0.02
IC50(nM) = 4.0
Kd(nM) = 1.8

4 P07550_DB00571 P07550 antagonist Beta-2 adrenergic receptor Ki(nM) = 0.01
IC50(nM) = 0.48
Kd(nM) = 0.1

5 P13945_DB00571 P13945 antagonist Beta-3 adrenergic receptor Ki(nM) = 186.0
Kd(nM) = 117.0

#	DrugDomain Data	UniProt Accession	Drug action	Protein name	Affinity data
1	P08908_DB00571	P08908	other/unknown	5-hydroxytryptamine receptor 1A	Ki(nM) = 31.0 IC50(nM) = 3981.0
2	P28222_DB00571	P28222	other/unknown	5-hydroxytryptamine receptor 1B	Ki(nM) = 56.23 IC50(nM) = 5012.0 EC50(nM) = 5012.0
3	P08588_DB00571	P08588	antagonist	Beta-1 adrenergic receptor	Ki(nM) = 0.02 IC50(nM) = 4.0 Kd(nM) = 1.8
4	P07550_DB00571	P07550	antagonist	Beta-2 adrenergic receptor	Ki(nM) = 0.01 IC50(nM) = 0.48 Kd(nM) = 0.1
5	P13945_DB00571	P13945	antagonist	Beta-3 adrenergic receptor	Ki(nM) = 186.0 Kd(nM) = 117.0