DB00589 Lisuride
InChI Key: BKRGVLQUQGGVSM-KBXCAEBGSA-N
SMILES: [H][C@@]12CC3=CNC4=CC=CC(=C34)C1=C[C@@H](CN2C)NC(=O)N(CC)CC
Small molecule PDB accession : H8G
List of proteins that are targets for DB00589
# | DrugDomain Data | UniProt Accession | Drug action | Protein name | Affinity data |
---|---|---|---|---|---|
1 | P21918_DB00589 | P21918 | antagonist | D | |
2 | P34969_DB00589 | P34969 | n/a | 5-hydroxytryptamine receptor 7 | |
3 | P28221_DB00589 | P28221 | agonist | 5-hydroxytryptamine receptor 1D | |
4 | P08908_DB00589 | P08908 | agonist | 5-hydroxytryptamine receptor 1A | Ki(nM) = 0.4 Kd(nM) = 501.0 |
5 | P21728_DB00589 | P21728 | antagonist | D | Ki(nM) = 77.0 |
6 | P18825_DB00589 | P18825 | other/unknown | Alpha-2C adrenergic receptor | |
7 | P18089_DB00589 | P18089 | other/unknown | Alpha-2B adrenergic receptor | |
8 | P28335_DB00589 | P28335 | agonist | 5-hydroxytryptamine receptor 2C | Kd(nM) = 50119.0 |
9 | P28223_DB00589 | P28223 | agonist | 5-hydroxytryptamine receptor 2A | Ki(nM) = 6918.31 |
10 | P21917_DB00589 | P21917 | agonist | D | EC50(nM) = 89.0 |
11 | P14416_DB00589 | P14416 | agonist | D | Ki(nM) = 0.5 |
12 | P41595_DB00589 | P41595 | antagonist | 5-hydroxytryptamine receptor 2B | |
13 | P28222_DB00589 | P28222 | agonist | 5-hydroxytryptamine receptor 1B | |
14 | P35462_DB00589 | P35462 | agonist | D | Ki(nM) = 1.7 |
15 | P08913_DB00589 | P08913 | other/unknown | Alpha-2A adrenergic receptor |