DB00606 Cyclothiazide
InChI Key: BOCUKUHCLICSIY-UHFFFAOYSA-N
SMILES: NS(=O)(=O)C1=C(Cl)C=C2NC(NS(=O)(=O)C2=C1)C1CC2CC1C=C2
Small molecule PDB accession : n/a
List of proteins that are targets for DB00606
# | DrugDomain Data | UniProt Accession | Drug action | Protein name | Affinity data |
---|---|---|---|---|---|
1 | P54710_DB00606 | P54710 | inhibitor | Sodium/potassium-transporting ATPase subunit gamma | |
2 | P00915_DB00606 | P00915 | inhibitor | Carbonic anhydrase 1 | |
3 | P00918_DB00606 | P00918 | inhibitor | Carbonic anhydrase 2 | |
4 | Q6FHJ7_DB00606 | Q6FHJ7 | inhibitor | Secreted frizzled-related protein 4 |