DB00611 Butorphanol
InChI Key: IFKLAQQSCNILHL-QHAWAJNXSA-N
SMILES: [H][C@@]12CC3=C(C=C(O)C=C3)[C@]3(CCCC[C@@]13O)CCN2CC1CCC1
Small molecule PDB accession : n/a
List of proteins that are targets for DB00611
# | DrugDomain Data | UniProt Accession | Drug action | Protein name | Affinity data |
---|---|---|---|---|---|
1 | P35372_DB00611 | P35372 | antagonist | Mu-type opioid receptor | Ki(nM) = 0.12 IC50(nM) = 14.0 EC50(nM) = 3.3 |
2 | P41143_DB00611 | P41143 | agonist | Delta-type opioid receptor | Ki(nM) = 12.0 |
3 | P41145_DB00611 | P41145 | agonist | Kappa-type opioid receptor | Ki(nM) = 0.12 EC50(nM) = 2.9 |