DB00661 Verapamil
InChI Key: SGTNSNPWRIOYBX-UHFFFAOYSA-N
SMILES: COC1=C(OC)C=C(CCN(C)CCCC(C#N)(C(C)C)C2=CC(OC)=C(OC)C=C2)C=C1
Small molecule PDB accession : n/a
List of proteins that are targets for DB00661
# | DrugDomain Data | UniProt Accession | Drug action | Protein name | Affinity data |
---|---|---|---|---|---|
1 | O43497_DB00661 | O43497 | inhibitor | Voltage-dependent T-type calcium channel subunit alpha-1G | |
2 | Q14654_DB00661 | Q14654 | inhibitor | ATP-sensitive inward rectifier potassium channel 11 | |
3 | P08183_DB00661 | P08183 | inhibitor | ATP-dependent translocase ABCB1 | Ki(nM) = 880.0 IC50(nM) = 3.0 EC50(nM) = 120.0 |
4 | P31645_DB00661 | P31645 | unknown | Sodium-dependent serotonin transporter | |
5 | O00555_DB00661 | O00555 | inhibitor | Voltage-dependent P/Q-type calcium channel subunit alpha-1A | |
6 | Q00975_DB00661 | Q00975 | inhibitor | Voltage-dependent N-type calcium channel subunit alpha-1B | |
7 | Q13936_DB00661 | Q13936 | inhibitor | Voltage-dependent L-type calcium channel subunit alpha-1C | IC50(nM) = 150.0 |
8 | Q12809_DB00661 | Q12809 | inhibitor | Potassium voltage-gated channel subfamily H member 2 | IC50(nM) = 141.0 |
9 | O95180_DB00661 | O95180 | inhibitor | Voltage-dependent T-type calcium channel subunit alpha-1H | |
10 | P35368_DB00661 | P35368 | antagonist | Alpha-1B adrenergic receptor | |
11 | P35348_DB00661 | P35348 | antagonist | Alpha-1A adrenergic receptor | |
12 | P25100_DB00661 | P25100 | antagonist | Alpha-1D adrenergic receptor |