DB00704 Naltrexone
InChI Key: DQCKKXVULJGBQN-XFWGSAIBSA-N
SMILES: [H][C@@]12OC3=C(O)C=CC4=C3[C@@]11CCN(CC3CC3)[C@]([H])(C4)[C@]1(O)CCC2=O
Small molecule PDB accession : n/a
List of proteins that are targets for DB00704
| # | DrugDomain Data | UniProt Accession | Drug action | Protein name | Affinity data |
|---|---|---|---|---|---|
| 1 | P35372_DB00704 | P35372 | antagonist | Mu-type opioid receptor | Ki(nM) = 0.07 IC50(nM) = 0.59 EC50(nM) = 0.38 |
| 2 | Q99720_DB00704 | Q99720 | n/a | Sigma non-opioid intracellular receptor 1 | |
| 3 | P41143_DB00704 | P41143 | antagonist | Delta-type opioid receptor | Ki(nM) = 6.3 IC50(nM) = 0.55 EC50(nM) = 4.4 |
| 4 | P41145_DB00704 | P41145 | antagonist | Kappa-type opioid receptor | Ki(nM) = 0.042 IC50(nM) = 1.9 EC50(nM) = 0.81 |