DrugDomain - DB00704

DB00704 Naltrexone

InChI Key: DQCKKXVULJGBQN-XFWGSAIBSA-N
SMILES: [H][C@@]12OC3=C(O)C=CC4=C3[C@@]11CCN(CC3CC3)[C@]([H])(C4)[C@]1(O)CCC2=O
Small molecule PDB accession : n/a

List of proteins that are targets for DB00704

# DrugDomain Data UniProt Accession Drug action Protein name Affinity data

1 P35372_DB00704 P35372 antagonist Mu-type opioid receptor Ki(nM) = 0.07
IC50(nM) = 0.59
EC50(nM) = 0.38

2 Q99720_DB00704 Q99720 n/a Sigma non-opioid intracellular receptor 1

3 P41143_DB00704 P41143 antagonist Delta-type opioid receptor Ki(nM) = 6.3
IC50(nM) = 0.55
EC50(nM) = 4.4

4 P41145_DB00704 P41145 antagonist Kappa-type opioid receptor Ki(nM) = 0.042
IC50(nM) = 1.9
EC50(nM) = 0.81

#	DrugDomain Data	UniProt Accession	Drug action	Protein name	Affinity data
1	P35372_DB00704	P35372	antagonist	Mu-type opioid receptor	Ki(nM) = 0.07 IC50(nM) = 0.59 EC50(nM) = 0.38
2	Q99720_DB00704	Q99720	n/a	Sigma non-opioid intracellular receptor 1
3	P41143_DB00704	P41143	antagonist	Delta-type opioid receptor	Ki(nM) = 6.3 IC50(nM) = 0.55 EC50(nM) = 4.4
4	P41145_DB00704	P41145	antagonist	Kappa-type opioid receptor	Ki(nM) = 0.042 IC50(nM) = 1.9 EC50(nM) = 0.81