DB00714 Apomorphine

InChI Key: VMWNQDUVQKEIOC-CYBMUJFWSA-N
SMILES: [H][C@]12CC3=C(C(O)=C(O)C=C3)C3=CC=CC(CCN1C)=C23
Small molecule PDB accession : OR9

List of proteins that are targets for DB00714
# DrugDomain Data UniProt Accession Drug action Protein name Affinity data
1 P21918_DB00714 P21918 agonist D Ki(nM) = 14.79
2 P28221_DB00714 P28221 agonist 5-hydroxytryptamine receptor 1D Ki(nM) = 1230.27
3 P08908_DB00714 P08908 agonist 5-hydroxytryptamine receptor 1A Ki(nM) = 117.0
4 P21728_DB00714 P21728 agonist D Ki(nM) = 4.6
Kd(nM) = 680.0
EC50(nM) = 3.8
5 P18825_DB00714 P18825 agonist Alpha-2C adrenergic receptor Ki(nM) = 36.31
6 P18089_DB00714 P18089 agonist Alpha-2B adrenergic receptor Ki(nM) = 66.07
7 P28335_DB00714 P28335 agonist 5-hydroxytryptamine receptor 2C Ki(nM) = 102.33
8 P28223_DB00714 P28223 agonist 5-hydroxytryptamine receptor 2A Ki(nM) = 120.0
9 P21917_DB00714 P21917 agonist D Ki(nM) = 3.47
EC50(nM) = 1.5
10 P14416_DB00714 P14416 agonist D Ki(nM) = 0.62
IC50(nM) = 4.2
Kd(nM) = 0.66
EC50(nM) = 1.6
11 P41595_DB00714 P41595 agonist 5-hydroxytryptamine receptor 2B Ki(nM) = 131.83
12 P28222_DB00714 P28222 agonist 5-hydroxytryptamine receptor 1B Ki(nM) = 2951.21
13 P35462_DB00714 P35462 agonist D Ki(nM) = 2.6
IC50(nM) = 25.0
EC50(nM) = 7.0
14 P08913_DB00714 P08913 agonist Alpha-2A adrenergic receptor Ki(nM) = 141.25