DrugDomain - DB00715

DB00715 Paroxetine

InChI Key: AHOUBRCZNHFOSL-YOEHRIQHSA-N
SMILES: FC1=CC=C(C=C1)[C@@H]1CCNC[C@H]1COC1=CC2=C(OCO2)C=C1
Small molecule PDB accession : 8PR

List of proteins that are targets for DB00715

# DrugDomain Data UniProt Accession Drug action Protein name Affinity data

1 P28223_DB00715 P28223 agonist 5-hydroxytryptamine receptor 2A Ki(nM) = 10000.0

2 P31645_DB00715 P31645 inhibitor Sodium-dependent serotonin transporter Ki(nM) = 0.04
IC50(nM) = 0.2
Kd(nM) = 0.13

3 P14416_DB00715 P14416 other/unknown D Ki(nM) = 10000.0

4 P41595_DB00715 P41595 agonist 5-hydroxytryptamine receptor 2B Ki(nM) = 10000.0

5 P35367_DB00715 P35367 inhibitor Histamine H1 receptor Ki(nM) = 10000.0

6 P23975_DB00715 P23975 inhibitor Sodium-dependent noradrenaline transporter Ki(nM) = 40.0
IC50(nM) = 100.0
Kd(nM) = 40.0

#	DrugDomain Data	UniProt Accession	Drug action	Protein name	Affinity data
1	P28223_DB00715	P28223	agonist	5-hydroxytryptamine receptor 2A	Ki(nM) = 10000.0
2	P31645_DB00715	P31645	inhibitor	Sodium-dependent serotonin transporter	Ki(nM) = 0.04 IC50(nM) = 0.2 Kd(nM) = 0.13
3	P14416_DB00715	P14416	other/unknown	D	Ki(nM) = 10000.0
4	P41595_DB00715	P41595	agonist	5-hydroxytryptamine receptor 2B	Ki(nM) = 10000.0
5	P35367_DB00715	P35367	inhibitor	Histamine H1 receptor	Ki(nM) = 10000.0
6	P23975_DB00715	P23975	inhibitor	Sodium-dependent noradrenaline transporter	Ki(nM) = 40.0 IC50(nM) = 100.0 Kd(nM) = 40.0