DB00726 Trimipramine
InChI Key: ZSCDBOWYZJWBIY-UHFFFAOYSA-N
SMILES: CC(CN(C)C)CN1C2=CC=CC=C2CCC2=CC=CC=C12
Small molecule PDB accession : n/a
List of proteins that are targets for DB00726
| # | DrugDomain Data | UniProt Accession | Drug action | Protein name | Affinity data |
|---|---|---|---|---|---|
| 1 | P28221_DB00726 | P28221 | binder | 5-hydroxytryptamine receptor 1D | |
| 2 | P08908_DB00726 | P08908 | antagonist | 5-hydroxytryptamine receptor 1A | |
| 3 | P18089_DB00726 | P18089 | other/unknown | Alpha-2B adrenergic receptor | |
| 4 | P28335_DB00726 | P28335 | antagonist | 5-hydroxytryptamine receptor 2C | |
| 5 | P28223_DB00726 | P28223 | agonist | 5-hydroxytryptamine receptor 2A | |
| 6 | P31645_DB00726 | P31645 | inhibitor | Sodium-dependent serotonin transporter | Ki(nM) = 149.0 |
| 7 | P14416_DB00726 | P14416 | other/unknown | D | |
| 8 | P35367_DB00726 | P35367 | antagonist | Histamine H1 receptor | Ki(nM) = 1.4 |
| 9 | P08913_DB00726 | P08913 | antagonist | Alpha-2A adrenergic receptor | |
| 10 | P23975_DB00726 | P23975 | inhibitor | Sodium-dependent noradrenaline transporter | Ki(nM) = 2450.0 |
| 11 | P35368_DB00726 | P35368 | antagonist | Alpha-1B adrenergic receptor | |
| 12 | Q01959_DB00726 | Q01959 | inhibitor | Sodium-dependent dopamine transporter | Ki(nM) = 3780.0 |
| 13 | P35348_DB00726 | P35348 | antagonist | Alpha-1A adrenergic receptor | |
| 14 | P46098_DB00726 | P46098 | binder | 5-hydroxytryptamine receptor 3A |