DB00734 Risperidone

InChI Key: RAPZEAPATHNIPO-UHFFFAOYSA-N
SMILES: CC1=C(CCN2CCC(CC2)C2=NOC3=C2C=CC(F)=C3)C(=O)N2CCCCC2=N1
Small molecule PDB accession : n/a

List of proteins that are targets for DB00734
# DrugDomain Data UniProt Accession Drug action Protein name Affinity data
1 P34969_DB00734 P34969 antagonist 5-hydroxytryptamine receptor 7 Ki(nM) = 0.4
2 P28221_DB00734 P28221 antagonist 5-hydroxytryptamine receptor 1D Ki(nM) = 3.9
3 P08908_DB00734 P08908 antagonist 5-hydroxytryptamine receptor 1A Ki(nM) = 21.0
EC50(nM) = 10000.0
4 P21728_DB00734 P21728 antagonist D Ki(nM) = 21.0
5 P18825_DB00734 P18825 antagonist Alpha-2C adrenergic receptor Ki(nM) = 1.3
6 P18089_DB00734 P18089 antagonist Alpha-2B adrenergic receptor Ki(nM) = 8.5
7 P28335_DB00734 P28335 antagonist 5-hydroxytryptamine receptor 2C Ki(nM) = 6.4
IC50(nM) = 1.8
8 P28223_DB00734 P28223 antagonist 5-hydroxytryptamine receptor 2A Ki(nM) = 0.14
IC50(nM) = 0.707946
9 P14416_DB00734 P14416 antagonist D Ki(nM) = 0.3
IC50(nM) = 3.6
10 P35367_DB00734 P35367 antagonist Histamine H1 receptor Ki(nM) = 2.6
IC50(nM) = 454.0
11 P35368_DB00734 P35368 antagonist Alpha-1B adrenergic receptor
12 P35348_DB00734 P35348 antagonist Alpha-1A adrenergic receptor Ki(nM) = 0.7
IC50(nM) = 10.0