DB00734 Risperidone
InChI Key: RAPZEAPATHNIPO-UHFFFAOYSA-N
SMILES: CC1=C(CCN2CCC(CC2)C2=NOC3=C2C=CC(F)=C3)C(=O)N2CCCCC2=N1
Small molecule PDB accession : n/a
List of proteins that are targets for DB00734
# | DrugDomain Data | UniProt Accession | Drug action | Protein name | Affinity data |
---|---|---|---|---|---|
1 | P34969_DB00734 | P34969 | antagonist | 5-hydroxytryptamine receptor 7 | Ki(nM) = 0.4 |
2 | P28221_DB00734 | P28221 | antagonist | 5-hydroxytryptamine receptor 1D | Ki(nM) = 3.9 |
3 | P08908_DB00734 | P08908 | antagonist | 5-hydroxytryptamine receptor 1A | Ki(nM) = 21.0 EC50(nM) = 10000.0 |
4 | P21728_DB00734 | P21728 | antagonist | D | Ki(nM) = 21.0 |
5 | P18825_DB00734 | P18825 | antagonist | Alpha-2C adrenergic receptor | Ki(nM) = 1.3 |
6 | P18089_DB00734 | P18089 | antagonist | Alpha-2B adrenergic receptor | Ki(nM) = 8.5 |
7 | P28335_DB00734 | P28335 | antagonist | 5-hydroxytryptamine receptor 2C | Ki(nM) = 6.4 IC50(nM) = 1.8 |
8 | P28223_DB00734 | P28223 | antagonist | 5-hydroxytryptamine receptor 2A | Ki(nM) = 0.14 IC50(nM) = 0.707946 |
9 | P14416_DB00734 | P14416 | antagonist | D | Ki(nM) = 0.3 IC50(nM) = 3.6 |
10 | P35367_DB00734 | P35367 | antagonist | Histamine H1 receptor | Ki(nM) = 2.6 IC50(nM) = 454.0 |
11 | P35368_DB00734 | P35368 | antagonist | Alpha-1B adrenergic receptor | |
12 | P35348_DB00734 | P35348 | antagonist | Alpha-1A adrenergic receptor | Ki(nM) = 0.7 IC50(nM) = 10.0 |