DrugDomain - DB00773

DB00773 Etoposide

InChI Key: VJJPUSNTGOMMGY-MRVIYFEKSA-N
SMILES: [H][C@]12COC(=O)[C@]1([H])[C@H](C1=CC(OC)=C(O)C(OC)=C1)C1=CC3=C(OCO3)C=C1[C@H]2O[C@@H]1O[C@]2([H])CO[C@@H](C)O[C@@]2([H])[C@H](O)[C@H]1O
Small molecule PDB accession : EVP

List of proteins that are targets for DB00773

# DrugDomain Data UniProt Accession Drug action Protein name Affinity data

1 Q02880_DB00773 Q02880 inhibitor DNA topoisomerase 2-beta IC50(nM) = 70.0
EC50(nM) = 70000.0

2 P11388_DB00773 P11388 inhibitor DNA topoisomerase 2-alpha IC50(nM) = 21800.0
EC50(nM) = 810.0

#	DrugDomain Data	UniProt Accession	Drug action	Protein name	Affinity data
1	Q02880_DB00773	Q02880	inhibitor	DNA topoisomerase 2-beta	IC50(nM) = 70.0 EC50(nM) = 70000.0
2	P11388_DB00773	P11388	inhibitor	DNA topoisomerase 2-alpha	IC50(nM) = 21800.0 EC50(nM) = 810.0