DB00786 Marimastat
InChI Key: OCSMOTCMPXTDND-OUAUKWLOSA-N
SMILES: CNC(=O)[C@@H](NC(=O)[C@H](CC(C)C)[C@H](O)C(=O)NO)C(C)(C)C
Small molecule PDB accession : 097
List of proteins that are targets for DB00786
| # | DrugDomain Data | UniProt Accession | Drug action | Protein name | Affinity data |
|---|---|---|---|---|---|
| 1 | O60882_DB00786 | O60882 | inhibitor | Matrix metalloproteinase-20 | IC50(nM) = 10000.0 |
| 2 | P51512_DB00786 | P51512 | inhibitor | Matrix metalloproteinase-16 | IC50(nM) = 10000.0 |
| 3 | P09238_DB00786 | P09238 | antagonist | Stromelysin-2 | IC50(nM) = 10000.0 |
| 4 | P09237_DB00786 | P09237 | antagonist | Matrilysin | IC50(nM) = 4.1 |
| 5 | P39900_DB00786 | P39900 | inhibitor | Macrophage metalloelastase | IC50(nM) = 5.0 |
| 6 | P14780_DB00786 | P14780 | inhibitor | Matrix metalloproteinase-9 | Ki(nM) = 1.0 IC50(nM) = 0.79 |
| 7 | P45452_DB00786 | P45452 | inhibitor | Collagenase 3 | IC50(nM) = 0.74 |
| 8 | P08253_DB00786 | P08253 | inhibitor | 72 kDa type IV collagenase | Ki(nM) = 0.6 IC50(nM) = 0.41 |
| 9 | P50281_DB00786 | P50281 | inhibitor | Matrix metalloproteinase-14 | IC50(nM) = 1.8 |
| 10 | P08254_DB00786 | P08254 | antagonist | Stromelysin-1 | Ki(nM) = 2.4 IC50(nM) = 4.4 |
| 11 | P03956_DB00786 | P03956 | inhibitor | Interstitial collagenase | Ki(nM) = 0.7 IC50(nM) = 0.78 |
| 12 | P22894_DB00786 | P22894 | inhibitor | Neutrophil collagenase | IC50(nM) = 0.47 |
| 13 | Q9NPA2_DB00786 | Q9NPA2 | inhibitor | Matrix metalloproteinase-25 | IC50(nM) = 10000.0 |
| 14 | P24347_DB00786 | P24347 | antagonist | Stromelysin-3 | |
| 15 | O75900_DB00786 | O75900 | inhibitor | Matrix metalloproteinase-23 | |
| 16 | P51511_DB00786 | P51511 | inhibitor | Matrix metalloproteinase-15 | IC50(nM) = 10000.0 |
| 17 | Q8N119_DB00786 | Q8N119 | inhibitor | Matrix metalloproteinase-21 | |
| 18 | Q99542_DB00786 | Q99542 | inhibitor | Matrix metalloproteinase-19 | |
| 19 | Q9H239_DB00786 | Q9H239 | inhibitor | Matrix metalloproteinase-28 | |
| 20 | Q9H306_DB00786 | Q9H306 | inhibitor | Matrix metalloproteinase-27 | |
| 21 | Q9NRE1_DB00786 | Q9NRE1 | inhibitor | Matrix metalloproteinase-26 | IC50(nM) = 10000.0 |
| 22 | Q9ULZ9_DB00786 | Q9ULZ9 | inhibitor | Matrix metalloproteinase-17 | |
| 23 | Q9Y5R2_DB00786 | Q9Y5R2 | inhibitor | Matrix metalloproteinase-24 | IC50(nM) = 10000.0 |