DrugDomain - DB00813

DB00813 Fentanyl

InChI Key: PJMPHNIQZUBGLI-UHFFFAOYSA-N
SMILES: CCC(=O)N(C1CCN(CCC2=CC=CC=C2)CC1)C1=CC=CC=C1
Small molecule PDB accession : 7V7

List of proteins that are targets for DB00813

# DrugDomain Data UniProt Accession Drug action Protein name Affinity data

1 P35372_DB00813 P35372 agonist Mu-type opioid receptor Ki(nM) = 0.39
IC50(nM) = 1.3
EC50(nM) = 0.51

2 P08183_DB00813 P08183 n/a ATP-dependent translocase ABCB1 IC50(nM) = 6500.0

3 P41143_DB00813 P41143 agonist Delta-type opioid receptor Ki(nM) = 152.7
IC50(nM) = 187.0

4 P41145_DB00813 P41145 agonist Kappa-type opioid receptor Ki(nM) = 84.8
IC50(nM) = 1580.0

#	DrugDomain Data	UniProt Accession	Drug action	Protein name	Affinity data
1	P35372_DB00813	P35372	agonist	Mu-type opioid receptor	Ki(nM) = 0.39 IC50(nM) = 1.3 EC50(nM) = 0.51
2	P08183_DB00813	P08183	n/a	ATP-dependent translocase ABCB1	IC50(nM) = 6500.0
3	P41143_DB00813	P41143	agonist	Delta-type opioid receptor	Ki(nM) = 152.7 IC50(nM) = 187.0
4	P41145_DB00813	P41145	agonist	Kappa-type opioid receptor	Ki(nM) = 84.8 IC50(nM) = 1580.0