DB00819 Acetazolamide

InChI Key: BZKPWHYZMXOIDC-UHFFFAOYSA-N
SMILES: CC(=O)NC1=NN=C(S1)S(N)(=O)=O
Small molecule PDB accession : AZM

List of proteins that are targets for DB00819
# DrugDomain Data UniProt Accession Drug action Protein name Affinity data
1 Q9ULX7_DB00819 Q9ULX7 inhibitor Carbonic anhydrase 14 Ki(nM) = 5.7
IC50(nM) = 48.0
Kd(nM) = 2.1
2 P43166_DB00819 P43166 inhibitor Carbonic anhydrase 7 Ki(nM) = 2.0
IC50(nM) = 265.0
Kd(nM) = 2.4
3 P22748_DB00819 P22748 inhibitor Carbonic anhydrase 4 Ki(nM) = 8.6
IC50(nM) = 17.5
Kd(nM) = 12.0
4 P07451_DB00819 P07451 inhibitor Carbonic anhydrase 3 Ki(nM) = 3.1
IC50(nM) = 840.0
Kd(nM) = 4600.0
5 O43570_DB00819 O43570 inhibitor Carbonic anhydrase 12 Ki(nM) = 2.5
IC50(nM) = 5.7
Kd(nM) = 24.0
6 P29972_DB00819 P29972 inhibitor Aquaporin-1
7 P00915_DB00819 P00915 inhibitor Carbonic anhydrase 1 Ki(nM) = 0.25
IC50(nM) = 0.9957
Kd(nM) = 290.0
8 P00918_DB00819 P00918 inhibitor Carbonic anhydrase 2 Ki(nM) = 0.012
IC50(nM) = 0.485
Kd(nM) = 2.6
koff(s-1) = 0.06