DB00820 Tadalafil
InChI Key: WOXKDUGGOYFFRN-IIBYNOLFSA-N
SMILES: [H][C@]12CC3=C(NC4=CC=CC=C34)[C@H](N1C(=O)CN(C)C2=O)C1=CC2=C(OCO2)C=C1
Small molecule PDB accession : CIA
List of proteins that are targets for DB00820
# | DrugDomain Data | UniProt Accession | Drug action | Protein name | Affinity data |
---|---|---|---|---|---|
1 | P18545_DB00820 | P18545 | inhibitor | Retinal rod rhodopsin-sensitive cGMP 3',5'-cyclic phosphodiesterase subunit gamma | |
2 | O76074_DB00820 | O76074 | inhibitor | cGMP-specific 3',5'-cyclic phosphodiesterase | Ki(nM) = 5.2 IC50(nM) = 1.2 EC50(nM) = 5810.0 |
3 | Q9HCR9_DB00820 | Q9HCR9 | inhibitor | Dual 3',5'-cyclic-AMP and -GMP phosphodiesterase 11A | IC50(nM) = 10.0 |