DB00834 Mifepristone
InChI Key: VKHAHZOOUSRJNA-GCNJZUOMSA-N
SMILES: [H][C@@]12CC[C@@](O)(C#CC)[C@@]1(C)C[C@H](C1=CC=C(C=C1)N(C)C)C1=C3CCC(=O)C=C3CC[C@@]21[H]
Small molecule PDB accession : 486
List of proteins that are targets for DB00834
| # | DrugDomain Data | UniProt Accession | Drug action | Protein name | Affinity data |
|---|---|---|---|---|---|
| 1 | P07288_DB00834 | P07288 | n/a | Prostate-specific antigen | |
| 2 | P04150_DB00834 | P04150 | antagonist | Glucocorticoid receptor | Ki(nM) = 0.09 IC50(nM) = 0.008 Kd(nM) = 15.0 EC50(nM) = 0.6 |
| 3 | O75469_DB00834 | O75469 | n/a | Nuclear receptor subfamily 1 group I member 2 | |
| 4 | P06401_DB00834 | P06401 | antagonist | Progesterone receptor | Ki(nM) = 0.251189 IC50(nM) = 0.021 EC50(nM) = 0.3 |