DB00844 Nalbuphine
InChI Key: NETZHAKZCGBWSS-CEDHKZHLSA-N
SMILES: O[C@H]1CC[C@@]2(O)[C@H]3CC4=CC=C(O)C5=C4[C@@]2(CCN3CC2CCC2)[C@H]1O5
Small molecule PDB accession : n/a
List of proteins that are targets for DB00844
| # | DrugDomain Data | UniProt Accession | Drug action | Protein name | Affinity data |
|---|---|---|---|---|---|
| 1 | P35372_DB00844 | P35372 | antagonist | Mu-type opioid receptor | Ki(nM) = 0.89 IC50(nM) = 1.0 EC50(nM) = 14.0 |
| 2 | P41143_DB00844 | P41143 | antagonist | Delta-type opioid receptor | Ki(nM) = 240.0 IC50(nM) = 353.0 |
| 3 | P41145_DB00844 | P41145 | agonist | Kappa-type opioid receptor | Ki(nM) = 2.2 IC50(nM) = 83.0 EC50(nM) = 25.1 |