DrugDomain - DB00844

DB00844 Nalbuphine

InChI Key: NETZHAKZCGBWSS-CEDHKZHLSA-N
SMILES: O[C@H]1CC[C@@]2(O)[C@H]3CC4=CC=C(O)C5=C4[C@@]2(CCN3CC2CCC2)[C@H]1O5
Small molecule PDB accession : n/a

List of proteins that are targets for DB00844

# DrugDomain Data UniProt Accession Drug action Protein name Affinity data

1 P35372_DB00844 P35372 antagonist Mu-type opioid receptor Ki(nM) = 0.89
IC50(nM) = 1.0
EC50(nM) = 14.0

2 P41143_DB00844 P41143 antagonist Delta-type opioid receptor Ki(nM) = 240.0
IC50(nM) = 353.0

3 P41145_DB00844 P41145 agonist Kappa-type opioid receptor Ki(nM) = 2.2
IC50(nM) = 83.0
EC50(nM) = 25.1

#	DrugDomain Data	UniProt Accession	Drug action	Protein name	Affinity data
1	P35372_DB00844	P35372	antagonist	Mu-type opioid receptor	Ki(nM) = 0.89 IC50(nM) = 1.0 EC50(nM) = 14.0
2	P41143_DB00844	P41143	antagonist	Delta-type opioid receptor	Ki(nM) = 240.0 IC50(nM) = 353.0
3	P41145_DB00844	P41145	agonist	Kappa-type opioid receptor	Ki(nM) = 2.2 IC50(nM) = 83.0 EC50(nM) = 25.1