DB00849 Methylphenobarbital
InChI Key: ALARQZQTBTVLJV-UHFFFAOYSA-N
SMILES: CCC1(C(=O)NC(=O)N(C)C1=O)C1=CC=CC=C1
Small molecule PDB accession : n/a
List of proteins that are targets for DB00849
| # | DrugDomain Data | UniProt Accession | Drug action | Protein name | Affinity data |
|---|---|---|---|---|---|
| 1 | P48169_DB00849 | P48169 | potentiator | Gamma-aminobutyric acid receptor subunit alpha-4 | |
| 2 | P14867_DB00849 | P14867 | potentiator | Gamma-aminobutyric acid receptor subunit alpha-1 | |
| 3 | P31644_DB00849 | P31644 | potentiator | Gamma-aminobutyric acid receptor subunit alpha-5 | |
| 4 | Q13002_DB00849 | Q13002 | antagonist | Glutamate receptor ionotropic, kainate 2 | |
| 5 | P42262_DB00849 | P42262 | antagonist | Glutamate receptor 2 | |
| 6 | P36544_DB00849 | P36544 | antagonist | Neuronal acetylcholine receptor subunit alpha-7 | |
| 7 | P43681_DB00849 | P43681 | antagonist | Neuronal acetylcholine receptor subunit alpha-4 | |
| 8 | O75469_DB00849 | O75469 | activator | Nuclear receptor subfamily 1 group I member 2 | |
| 9 | P47869_DB00849 | P47869 | potentiator | Gamma-aminobutyric acid receptor subunit alpha-2 | |
| 10 | P34903_DB00849 | P34903 | potentiator | Gamma-aminobutyric acid receptor subunit alpha-3 | |
| 11 | Q16445_DB00849 | Q16445 | potentiator | Gamma-aminobutyric acid receptor subunit alpha-6 |