DB00869 Dorzolamide
InChI Key: IAVUPMFITXYVAF-XPUUQOCRSA-N
SMILES: CCN[C@H]1C[C@H](C)S(=O)(=O)C2=C1C=C(S2)S(N)(=O)=O
Small molecule PDB accession : ETS
List of proteins that are targets for DB00869
# | DrugDomain Data | UniProt Accession | Drug action | Protein name | Affinity data |
---|---|---|---|---|---|
1 | P22748_DB00869 | P22748 | inhibitor | Carbonic anhydrase 4 | Ki(nM) = 43.0 IC50(nM) = 32.0 |
2 | P07451_DB00869 | P07451 | inhibitor | Carbonic anhydrase 3 | Ki(nM) = 8000.0 |
3 | P00915_DB00869 | P00915 | inhibitor | Carbonic anhydrase 1 | Ki(nM) = 500.0 IC50(nM) = 1583.63 |
4 | P00918_DB00869 | P00918 | inhibitor | Carbonic anhydrase 2 | Ki(nM) = 0.111 IC50(nM) = 0.23 Kd(nM) = 0.043 |