DB00869 Dorzolamide

InChI Key: IAVUPMFITXYVAF-XPUUQOCRSA-N
SMILES: CCN[C@H]1C[C@H](C)S(=O)(=O)C2=C1C=C(S2)S(N)(=O)=O
Small molecule PDB accession : ETS

List of proteins that are targets for DB00869
# DrugDomain Data UniProt Accession Drug action Protein name Affinity data
1 P22748_DB00869 P22748 inhibitor Carbonic anhydrase 4 Ki(nM) = 43.0
IC50(nM) = 32.0
2 P07451_DB00869 P07451 inhibitor Carbonic anhydrase 3 Ki(nM) = 8000.0
3 P00915_DB00869 P00915 inhibitor Carbonic anhydrase 1 Ki(nM) = 500.0
IC50(nM) = 1583.63
4 P00918_DB00869 P00918 inhibitor Carbonic anhydrase 2 Ki(nM) = 0.111
IC50(nM) = 0.23
Kd(nM) = 0.043