DB00908 Quinidine
InChI Key: LOUPRKONTZGTKE-LHHVKLHASA-N
SMILES: [H][C@@]12CCN(C[C@@H]1C=C)[C@]([H])(C2)[C@@H](O)C1=C2C=C(OC)C=CC2=NC=C1
Small molecule PDB accession : QDN
List of proteins that are targets for DB00908
# | DrugDomain Data | UniProt Accession | Drug action | Protein name | Affinity data |
---|---|---|---|---|---|
1 | O00180_DB00908 | O00180 | inhibitor | Potassium channel subfamily K member 1 | |
2 | Q14524_DB00908 | Q14524 | inhibitor | Sodium channel protein type 5 subunit alpha | |
3 | Q12809_DB00908 | Q12809 | inhibitor | Potassium voltage-gated channel subfamily H member 2 | IC50(nM) = 324.0 |
4 | P35368_DB00908 | P35368 | antagonist | Alpha-1B adrenergic receptor | |
5 | P35348_DB00908 | P35348 | antagonist | Alpha-1A adrenergic receptor | |
6 | P25100_DB00908 | P25100 | antagonist | Alpha-1D adrenergic receptor | |
7 | Q9Y257_DB00908 | Q9Y257 | inhibitor | Potassium channel subfamily K member 6 |