DB00921 Buprenorphine
InChI Key: RMRJXGBAOAMLHD-IHFGGWKQSA-N
SMILES: CO[C@]12CC[C@@]3(C[C@@H]1[C@](C)(O)C(C)(C)C)[C@H]1CC4=C5C(O[C@@H]2[C@@]35CCN1CC1CC1)=C(O)C=C4
Small molecule PDB accession : n/a
List of proteins that are targets for DB00921
# | DrugDomain Data | UniProt Accession | Drug action | Protein name | Affinity data |
---|---|---|---|---|---|
1 | P35372_DB00921 | P35372 | partial agonist | Mu-type opioid receptor | Ki(nM) = 0.21 IC50(nM) = 0.59 EC50(nM) = 0.11 |
2 | P41143_DB00921 | P41143 | antagonist | Delta-type opioid receptor | Ki(nM) = 2.9 IC50(nM) = 0.9 EC50(nM) = 10000.0 |
3 | P41146_DB00921 | P41146 | n/a | Nociceptin receptor | Ki(nM) = 77.0 EC50(nM) = 116.0 |
4 | P41145_DB00921 | P41145 | antagonist | Kappa-type opioid receptor | Ki(nM) = 0.04 IC50(nM) = 1.2 EC50(nM) = 0.18 |