DB01023 Felodipine
InChI Key: RZTAMFZIAATZDJ-UHFFFAOYSA-N
SMILES: CCOC(=O)C1=C(C)NC(C)=C(C1C1=C(Cl)C(Cl)=CC=C1)C(=O)OC
Small molecule PDB accession : n/a
List of proteins that are targets for DB01023
| # | DrugDomain Data | UniProt Accession | Drug action | Protein name | Affinity data |
|---|---|---|---|---|---|
| 1 | P54289_DB01023 | P54289 | inhibitor | Voltage-dependent calcium channel subunit alpha-2/delta-1 | |
| 2 | P02585_DB01023 | P02585 | other | Troponin C, skeletal muscle | |
| 3 | Q01668_DB01023 | Q01668 | inhibitor | Voltage-dependent L-type calcium channel subunit alpha-1D | |
| 4 | Q13698_DB01023 | Q13698 | inhibitor | Voltage-dependent L-type calcium channel subunit alpha-1S | |
| 5 | P08235_DB01023 | P08235 | antagonist | Mineralocorticoid receptor | |
| 6 | Q01064_DB01023 | Q01064 | inhibitor | Calcium/calmodulin-dependent 3',5'-cyclic nucleotide phosphodiesterase 1B | |
| 7 | Q13936_DB01023 | Q13936 | inhibitor | Voltage-dependent L-type calcium channel subunit alpha-1C | |
| 8 | P0DP23_DB01023 | P0DP23 | other | Calmodulin-1 | |
| 9 | P63316_DB01023 | P63316 | other | Troponin C, slow skeletal and cardiac muscles | |
| 10 | O95180_DB01023 | O95180 | inhibitor | Voltage-dependent T-type calcium channel subunit alpha-1H | |
| 11 | Q9NY47_DB01023 | Q9NY47 | inhibitor | Voltage-dependent calcium channel subunit alpha-2/delta-2 | |
| 12 | P54750_DB01023 | P54750 | inhibitor | Calcium/calmodulin-dependent 3',5'-cyclic nucleotide phosphodiesterase 1A | |
| 13 | Q08289_DB01023 | Q08289 | inhibitor | Voltage-dependent L-type calcium channel subunit beta-2 |