DB01065 Melatonin

InChI Key: DRLFMBDRBRZALE-UHFFFAOYSA-N
SMILES: COC1=CC2=C(NC=C2CCNC(C)=O)C=C1
Small molecule PDB accession : ML1

List of proteins that are targets for DB01065
# DrugDomain Data UniProt Accession Drug action Protein name Affinity data
1 P49286_DB01065 P49286 agonist Melatonin receptor type 1B Ki(nM) = 0.12
IC50(nM) = 0.3
EC50(nM) = 0.069
2 P48039_DB01065 P48039 agonist Melatonin receptor type 1A Ki(nM) = 0.08
IC50(nM) = 0.017
Kd(nM) = 0.0915
EC50(nM) = 0.022
3 P46597_DB01065 P46597 n/a Acetylserotonin O-methyltransferase
4 P27797_DB01065 P27797 n/a Calreticulin
5 P16083_DB01065 P16083 n/a Ribosyldihydronicotinamide dehydrogenase [quinone] Ki(nM) = 28.0
IC50(nM) = 64.57
6 P05164_DB01065 P05164 inhibitor Myeloperoxidase IC50(nM) = 3000.0
7 P0DP23_DB01065 P0DP23 n/a Calmodulin-1
8 P03372_DB01065 P03372 antagonist Estrogen receptor
9 P11678_DB01065 P11678 inhibitor Eosinophil peroxidase
10 Q92753_DB01065 Q92753 agonist Nuclear receptor ROR-beta