DB01094 Hesperetin
InChI Key: AIONOLUJZLIMTK-AWEZNQCLSA-N
SMILES: COC1=C(O)C=C(C=C1)[C@@H]1CC(=O)C2=C(O)C=C(O)C=C2O1
Small molecule PDB accession : 6JP
List of proteins that are targets for DB01094
# | DrugDomain Data | UniProt Accession | Drug action | Protein name | Affinity data |
---|---|---|---|---|---|
1 | P55157_DB01094 | P55157 | antagonist | Microsomal triglyceride transfer protein large subunit | |
2 | O75908_DB01094 | O75908 | inhibitor | Sterol O-acyltransferase 2 | |
3 | P35610_DB01094 | P35610 | inhibitor | Sterol O-acyltransferase 1 | |
4 | P04278_DB01094 | P04278 | n/a | Sex hormone-binding globulin |