DB01119 Diazoxide
InChI Key: GDLBFKVLRPITMI-UHFFFAOYSA-N
SMILES: CC1=NS(=O)(=O)C2=C(N1)C=CC(Cl)=C2
Small molecule PDB accession : 20J
List of proteins that are targets for DB01119
# | DrugDomain Data | UniProt Accession | Drug action | Protein name | Affinity data |
---|---|---|---|---|---|
1 | P05023_DB01119 | P05023 | other | Sodium/potassium-transporting ATPase subunit alpha-1 | |
2 | Q14654_DB01119 | Q14654 | inducer | ATP-sensitive inward rectifier potassium channel 11 | |
3 | Q12791_DB01119 | Q12791 | other | Calcium-activated potassium channel subunit alpha-1 | |
4 | P00915_DB01119 | P00915 | inhibitor | Carbonic anhydrase 1 | |
5 | P00918_DB01119 | P00918 | inhibitor | Carbonic anhydrase 2 |