DB01149 Nefazodone
InChI Key: VRBKIVRKKCLPHA-UHFFFAOYSA-N
SMILES: CCC1=NN(CCCN2CCN(CC2)C2=CC(Cl)=CC=C2)C(=O)N1CCOC1=CC=CC=C1
Small molecule PDB accession : n/a
List of proteins that are targets for DB01149
# | DrugDomain Data | UniProt Accession | Drug action | Protein name | Affinity data |
---|---|---|---|---|---|
1 | P08908_DB01149 | P08908 | antagonist | 5-hydroxytryptamine receptor 1A | Ki(nM) = 80.0 |
2 | P28335_DB01149 | P28335 | antagonist | 5-hydroxytryptamine receptor 2C | Ki(nM) = 26.0 |
3 | P28223_DB01149 | P28223 | antagonist | 5-hydroxytryptamine receptor 2A | Ki(nM) = 5.8 |
4 | P31645_DB01149 | P31645 | inhibitor | Sodium-dependent serotonin transporter | Ki(nM) = 200.0 Kd(nM) = 200.0 |
5 | P08913_DB01149 | P08913 | antagonist | Alpha-2A adrenergic receptor | Ki(nM) = 84.0 |
6 | Q12809_DB01149 | Q12809 | antagonist | Potassium voltage-gated channel subfamily H member 2 | |
7 | P23975_DB01149 | P23975 | inhibitor | Sodium-dependent noradrenaline transporter | Ki(nM) = 360.0 Kd(nM) = 360.0 |
8 | P35368_DB01149 | P35368 | other/unknown | Alpha-1B adrenergic receptor | |
9 | Q01959_DB01149 | Q01959 | inhibitor | Sodium-dependent dopamine transporter | Ki(nM) = 360.0 Kd(nM) = 360.0 |
10 | P35348_DB01149 | P35348 | antagonist | Alpha-1A adrenergic receptor | Ki(nM) = 5.5 |