DB01162 Terazosin
InChI Key: VCKUSRYTPJJLNI-UHFFFAOYSA-N
SMILES: COC1=C(OC)C=C2C(N)=NC(=NC2=C1)N1CCN(CC1)C(=O)C1CCCO1
Small molecule PDB accession : n/a
List of proteins that are targets for DB01162
| # | DrugDomain Data | UniProt Accession | Drug action | Protein name | Affinity data |
|---|---|---|---|---|---|
| 1 | Q9NS40_DB01162 | Q9NS40 | inhibitor | Potassium voltage-gated channel subfamily H member 7 | |
| 2 | P01137_DB01162 | P01137 | inducer | Transforming growth factor beta-1 proprotein [Cleaved into: Latency-associated peptide | |
| 3 | Q12809_DB01162 | Q12809 | inhibitor | Potassium voltage-gated channel subfamily H member 2 | IC50(nM) = 17782.79 |
| 4 | P35368_DB01162 | P35368 | antagonist | Alpha-1B adrenergic receptor | Ki(nM) = 1.15 EC50(nM) = 0.5 |
| 5 | P35348_DB01162 | P35348 | antagonist | Alpha-1A adrenergic receptor | Ki(nM) = 1.82 IC50(nM) = 5.0 EC50(nM) = 51.0 |
| 6 | Q9H252_DB01162 | Q9H252 | inhibitor | Potassium voltage-gated channel subfamily H member 6 | |
| 7 | P25100_DB01162 | P25100 | antagonist | Alpha-1D adrenergic receptor | Ki(nM) = 0.66 |