DB01183 Naloxone
InChI Key: UZHSEJADLWPNLE-GRGSLBFTSA-N
SMILES: OC1=CC=C2C[C@H]3N(CC=C)CC[C@@]45[C@@H](OC1=C24)C(=O)CC[C@@]35O
Small molecule PDB accession : n/a
List of proteins that are targets for DB01183
# | DrugDomain Data | UniProt Accession | Drug action | Protein name | Affinity data |
---|---|---|---|---|---|
1 | P35372_DB01183 | P35372 | antagonist | Mu-type opioid receptor | Ki(nM) = 0.23 IC50(nM) = 2.0 |
2 | P41143_DB01183 | P41143 | antagonist | Delta-type opioid receptor | Ki(nM) = 16.0 IC50(nM) = 4.3 |
3 | P41145_DB01183 | P41145 | antagonist | Kappa-type opioid receptor | Ki(nM) = 0.25 IC50(nM) = 1.5 EC50(nM) = 6.6 |
4 | O00206_DB01183 | O00206 | inhibitor | Toll-like receptor 4 | |
5 | P16220_DB01183 | P16220 | other/unknown | Cyclic AMP-responsive element-binding protein 1 | |
6 | P23141_DB01183 | P23141 | binder | Liver carboxylesterase 1 | |
7 | P03372_DB01183 | P03372 | antagonist | Estrogen receptor |