DB01200 Bromocriptine
InChI Key: OZVBMTJYIDMWIL-AYFBDAFISA-N
SMILES: [H][C@@]12CCCN1C(=O)[C@H](CC(C)C)N1C(=O)[C@](NC(=O)[C@H]3CN(C)[C@]4([H])CC5=C(Br)NC6=CC=CC(=C56)C4=C3)(O[C@@]21O)C(C)C
Small molecule PDB accession : 08Y
List of proteins that are targets for DB01200
| # | DrugDomain Data | UniProt Accession | Drug action | Protein name | Affinity data |
|---|---|---|---|---|---|
| 1 | P21918_DB01200 | P21918 | agonist | D | Ki(nM) = 454.0 |
| 2 | P34969_DB01200 | P34969 | antagonist | 5-hydroxytryptamine receptor 7 | |
| 3 | P28221_DB01200 | P28221 | agonist | 5-hydroxytryptamine receptor 1D | Ki(nM) = 10.72 |
| 4 | P08908_DB01200 | P08908 | agonist | 5-hydroxytryptamine receptor 1A | Ki(nM) = 12.88 |
| 5 | P21728_DB01200 | P21728 | agonist | D | Ki(nM) = 672.0 |
| 6 | P18825_DB01200 | P18825 | agonist | Alpha-2C adrenergic receptor | Ki(nM) = 28.18 |
| 7 | P18089_DB01200 | P18089 | agonist | Alpha-2B adrenergic receptor | Ki(nM) = 34.67 |
| 8 | P28335_DB01200 | P28335 | agonist | 5-hydroxytryptamine receptor 2C | Ki(nM) = 741.31 |
| 9 | P28223_DB01200 | P28223 | agonist | 5-hydroxytryptamine receptor 2A | Ki(nM) = 107.15 |
| 10 | P21917_DB01200 | P21917 | antagonist | D | Ki(nM) = 285.0 |
| 11 | P14416_DB01200 | P14416 | agonist | D | Ki(nM) = 0.62 |
| 12 | P41595_DB01200 | P41595 | agonist | 5-hydroxytryptamine receptor 2B | Ki(nM) = 56.23 |
| 13 | P28222_DB01200 | P28222 | agonist | 5-hydroxytryptamine receptor 1B | Ki(nM) = 354.81 |
| 14 | P35462_DB01200 | P35462 | agonist | D | Ki(nM) = 2.1 |
| 15 | P08913_DB01200 | P08913 | agonist | Alpha-2A adrenergic receptor | Ki(nM) = 10.96 |
| 16 | P35368_DB01200 | P35368 | antagonist | Alpha-1B adrenergic receptor | Ki(nM) = 1.38 |
| 17 | P35348_DB01200 | P35348 | antagonist | Alpha-1A adrenergic receptor | Ki(nM) = 4.17 |
| 18 | P25100_DB01200 | P25100 | agonist | Alpha-1D adrenergic receptor | Ki(nM) = 1.12 |