DB01224 Quetiapine
InChI Key: URKOMYMAXPYINW-UHFFFAOYSA-N
SMILES: OCCOCCN1CCN(CC1)C1=NC2=CC=CC=C2SC2=CC=CC=C12
Small molecule PDB accession : n/a
List of proteins that are targets for DB01224
| # | DrugDomain Data | UniProt Accession | Drug action | Protein name | Affinity data |
|---|---|---|---|---|---|
| 1 | P21918_DB01224 | P21918 | ligand | D | Ki(nM) = 1513.0 |
| 2 | P34969_DB01224 | P34969 | ligand | 5-hydroxytryptamine receptor 7 | Ki(nM) = 63.0 |
| 3 | P50406_DB01224 | P50406 | antagonist | 5-hydroxytryptamine receptor 6 | Ki(nM) = 33.0 |
| 4 | P28566_DB01224 | P28566 | ligand | 5-hydroxytryptamine receptor 1E | Ki(nM) = 1250.0 |
| 5 | P28221_DB01224 | P28221 | ligand | 5-hydroxytryptamine receptor 1D | Ki(nM) = 560.0 |
| 6 | P08908_DB01224 | P08908 | antagonist | 5-hydroxytryptamine receptor 1A | Ki(nM) = 79.0 |
| 7 | P21728_DB01224 | P21728 | antagonist | D | Ki(nM) = 390.0 |
| 8 | P08912_DB01224 | P08912 | ligand | Muscarinic acetylcholine receptor M5 | Ki(nM) = 2990.0 |
| 9 | P18825_DB01224 | P18825 | antagonist | Alpha-2C adrenergic receptor | Ki(nM) = 28.7 |
| 10 | P18089_DB01224 | P18089 | antagonist | Alpha-2B adrenergic receptor | Ki(nM) = 90.0 |
| 11 | P28335_DB01224 | P28335 | ligand | 5-hydroxytryptamine receptor 2C | Ki(nM) = 615.0 |
| 12 | P28223_DB01224 | P28223 | antagonist | 5-hydroxytryptamine receptor 2A | Ki(nM) = 31.0 |
| 13 | P21917_DB01224 | P21917 | ligand | D | Ki(nM) = 500.0 |
| 14 | P08173_DB01224 | P08173 | ligand | Muscarinic acetylcholine receptor M4 | Ki(nM) = 126.0 |
| 15 | P11229_DB01224 | P11229 | antagonist | Muscarinic acetylcholine receptor M1 | Ki(nM) = 56.0 EC50(nM) = 10000.0 |
| 16 | P14416_DB01224 | P14416 | antagonist | D | Ki(nM) = 16.0 |
| 17 | P28222_DB01224 | P28222 | ligand | 5-hydroxytryptamine receptor 1B | Ki(nM) = 2050.0 |
| 18 | P08172_DB01224 | P08172 | ligand | Muscarinic acetylcholine receptor M2 | Ki(nM) = 630.0 |
| 19 | P35367_DB01224 | P35367 | antagonist | Histamine H1 receptor | Ki(nM) = 2.2 |
| 20 | P35462_DB01224 | P35462 | ligand | D | Ki(nM) = 9.2 |
| 21 | P20309_DB01224 | P20309 | antagonist | Muscarinic acetylcholine receptor M3 | Ki(nM) = 705.0 |
| 22 | P08913_DB01224 | P08913 | antagonist | Alpha-2A adrenergic receptor | Ki(nM) = 80.0 |
| 23 | P46098_DB01224 | P46098 | ligand | 5-hydroxytryptamine receptor 3A |