DB01238 Aripiprazole
InChI Key: CEUORZQYGODEFX-UHFFFAOYSA-N
SMILES: ClC1=CC=CC(N2CCN(CCCCOC3=CC4=C(CCC(=O)N4)C=C3)CC2)=C1Cl
Small molecule PDB accession : 9SC
List of proteins that are targets for DB01238
# | DrugDomain Data | UniProt Accession | Drug action | Protein name | Affinity data |
---|---|---|---|---|---|
1 | P21918_DB01238 | P21918 | antagonist | D | Ki(nM) = 1051.0 |
2 | P35372_DB01238 | P35372 | ligand | Mu-type opioid receptor | Ki(nM) = 10000.0 |
3 | P34969_DB01238 | P34969 | antagonist | 5-hydroxytryptamine receptor 7 | Ki(nM) = 9.6 |
4 | P50406_DB01238 | P50406 | antagonist | 5-hydroxytryptamine receptor 6 | Ki(nM) = 89.0 |
5 | P47898_DB01238 | P47898 | ligand | 5-hydroxytryptamine receptor 5A | Ki(nM) = 1240.0 |
6 | P25021_DB01238 | P25021 | ligand | Histamine H2 receptor | Ki(nM) = 10000.0 |
7 | Q9Y5N1_DB01238 | Q9Y5N1 | ligand | Histamine H3 receptor | Ki(nM) = 2361.0 |
8 | P28566_DB01238 | P28566 | antagonist | 5-hydroxytryptamine receptor 1E | Ki(nM) = 8000.0 |
9 | P28221_DB01238 | P28221 | antagonist | 5-hydroxytryptamine receptor 1D | Ki(nM) = 68.0 |
10 | P08908_DB01238 | P08908 | partial agonist | 5-hydroxytryptamine receptor 1A | Ki(nM) = 1.7 EC50(nM) = 24.0 |
11 | P21728_DB01238 | P21728 | antagonist | D | Ki(nM) = 310.0 |
12 | P08912_DB01238 | P08912 | ligand | Muscarinic acetylcholine receptor M5 | Ki(nM) = 2330.0 |
13 | P18825_DB01238 | P18825 | antagonist | Alpha-2C adrenergic receptor | Ki(nM) = 37.0 |
14 | P18089_DB01238 | P18089 | antagonist | Alpha-2B adrenergic receptor | Ki(nM) = 102.0 |
15 | P28335_DB01238 | P28335 | antagonist | 5-hydroxytryptamine receptor 2C | Ki(nM) = 18.0 IC50(nM) = 1380.0 |
16 | P28223_DB01238 | P28223 | antagonist | 5-hydroxytryptamine receptor 2A | Ki(nM) = 0.8 IC50(nM) = 1100.0 |
17 | P21917_DB01238 | P21917 | antagonist | D | Ki(nM) = 44.0 |
18 | P31645_DB01238 | P31645 | modulator | Sodium-dependent serotonin transporter | Ki(nM) = 32.0 |
19 | P08173_DB01238 | P08173 | ligand | Muscarinic acetylcholine receptor M4 | Ki(nM) = 1520.0 |
20 | P11229_DB01238 | P11229 | ligand | Muscarinic acetylcholine receptor M1 | Ki(nM) = 6780.0 |
21 | P14416_DB01238 | P14416 | antagonist | D | Ki(nM) = 0.2 IC50(nM) = 7.6 EC50(nM) = 1.0 |
22 | P41143_DB01238 | P41143 | ligand | Delta-type opioid receptor | Ki(nM) = 10000.0 |
23 | P41595_DB01238 | P41595 | inverse agonist | 5-hydroxytryptamine receptor 2B | Ki(nM) = 0.36 |
24 | P28222_DB01238 | P28222 | antagonist | 5-hydroxytryptamine receptor 1B | Ki(nM) = 830.0 |
25 | P41145_DB01238 | P41145 | ligand | Kappa-type opioid receptor | Ki(nM) = 10000.0 |
26 | P08172_DB01238 | P08172 | ligand | Muscarinic acetylcholine receptor M2 | Ki(nM) = 3510.0 |
27 | P35367_DB01238 | P35367 | antagonist | Histamine H1 receptor | Ki(nM) = 25.0 IC50(nM) = 420.0 |
28 | P35462_DB01238 | P35462 | antagonist | D | Ki(nM) = 0.8 EC50(nM) = 19.0 |
29 | P08588_DB01238 | P08588 | ligand | Beta-1 adrenergic receptor | Ki(nM) = 141.0 |
30 | P20309_DB01238 | P20309 | ligand | Muscarinic acetylcholine receptor M3 | Ki(nM) = 4677.0 IC50(nM) = 100000.0 |
31 | P08913_DB01238 | P08913 | antagonist | Alpha-2A adrenergic receptor | Ki(nM) = 74.0 |
32 | P07550_DB01238 | P07550 | ligand | Beta-2 adrenergic receptor | Ki(nM) = 163.0 |
33 | P35368_DB01238 | P35368 | antagonist | Alpha-1B adrenergic receptor | Ki(nM) = 34.8 |
34 | Q01959_DB01238 | Q01959 | modulator | Sodium-dependent dopamine transporter | Ki(nM) = 3220.0 |
35 | P35348_DB01238 | P35348 | antagonist | Alpha-1A adrenergic receptor | Ki(nM) = 8.9 IC50(nM) = 170.0 |
36 | P46098_DB01238 | P46098 | antagonist | 5-hydroxytryptamine receptor 3A | |
37 | Q9H3N8_DB01238 | Q9H3N8 | ligand | Histamine H4 receptor | Ki(nM) = 10000.0 |