DB01238 Aripiprazole

InChI Key: CEUORZQYGODEFX-UHFFFAOYSA-N
SMILES: ClC1=CC=CC(N2CCN(CCCCOC3=CC4=C(CCC(=O)N4)C=C3)CC2)=C1Cl
Small molecule PDB accession : 9SC

List of proteins that are targets for DB01238
# DrugDomain Data UniProt Accession Drug action Protein name Affinity data
1 P21918_DB01238 P21918 antagonist D Ki(nM) = 1051.0
2 P35372_DB01238 P35372 ligand Mu-type opioid receptor Ki(nM) = 10000.0
3 P34969_DB01238 P34969 antagonist 5-hydroxytryptamine receptor 7 Ki(nM) = 9.6
4 P50406_DB01238 P50406 antagonist 5-hydroxytryptamine receptor 6 Ki(nM) = 89.0
5 P47898_DB01238 P47898 ligand 5-hydroxytryptamine receptor 5A Ki(nM) = 1240.0
6 P25021_DB01238 P25021 ligand Histamine H2 receptor Ki(nM) = 10000.0
7 Q9Y5N1_DB01238 Q9Y5N1 ligand Histamine H3 receptor Ki(nM) = 2361.0
8 P28566_DB01238 P28566 antagonist 5-hydroxytryptamine receptor 1E Ki(nM) = 8000.0
9 P28221_DB01238 P28221 antagonist 5-hydroxytryptamine receptor 1D Ki(nM) = 68.0
10 P08908_DB01238 P08908 partial agonist 5-hydroxytryptamine receptor 1A Ki(nM) = 1.7
EC50(nM) = 24.0
11 P21728_DB01238 P21728 antagonist D Ki(nM) = 310.0
12 P08912_DB01238 P08912 ligand Muscarinic acetylcholine receptor M5 Ki(nM) = 2330.0
13 P18825_DB01238 P18825 antagonist Alpha-2C adrenergic receptor Ki(nM) = 37.0
14 P18089_DB01238 P18089 antagonist Alpha-2B adrenergic receptor Ki(nM) = 102.0
15 P28335_DB01238 P28335 antagonist 5-hydroxytryptamine receptor 2C Ki(nM) = 18.0
IC50(nM) = 1380.0
16 P28223_DB01238 P28223 antagonist 5-hydroxytryptamine receptor 2A Ki(nM) = 0.8
IC50(nM) = 1100.0
17 P21917_DB01238 P21917 antagonist D Ki(nM) = 44.0
18 P31645_DB01238 P31645 modulator Sodium-dependent serotonin transporter Ki(nM) = 32.0
19 P08173_DB01238 P08173 ligand Muscarinic acetylcholine receptor M4 Ki(nM) = 1520.0
20 P11229_DB01238 P11229 ligand Muscarinic acetylcholine receptor M1 Ki(nM) = 6780.0
21 P14416_DB01238 P14416 antagonist D Ki(nM) = 0.2
IC50(nM) = 7.6
EC50(nM) = 1.0
22 P41143_DB01238 P41143 ligand Delta-type opioid receptor Ki(nM) = 10000.0
23 P41595_DB01238 P41595 inverse agonist 5-hydroxytryptamine receptor 2B Ki(nM) = 0.36
24 P28222_DB01238 P28222 antagonist 5-hydroxytryptamine receptor 1B Ki(nM) = 830.0
25 P41145_DB01238 P41145 ligand Kappa-type opioid receptor Ki(nM) = 10000.0
26 P08172_DB01238 P08172 ligand Muscarinic acetylcholine receptor M2 Ki(nM) = 3510.0
27 P35367_DB01238 P35367 antagonist Histamine H1 receptor Ki(nM) = 25.0
IC50(nM) = 420.0
28 P35462_DB01238 P35462 antagonist D Ki(nM) = 0.8
EC50(nM) = 19.0
29 P08588_DB01238 P08588 ligand Beta-1 adrenergic receptor Ki(nM) = 141.0
30 P20309_DB01238 P20309 ligand Muscarinic acetylcholine receptor M3 Ki(nM) = 4677.0
IC50(nM) = 100000.0
31 P08913_DB01238 P08913 antagonist Alpha-2A adrenergic receptor Ki(nM) = 74.0
32 P07550_DB01238 P07550 ligand Beta-2 adrenergic receptor Ki(nM) = 163.0
33 P35368_DB01238 P35368 antagonist Alpha-1B adrenergic receptor Ki(nM) = 34.8
34 Q01959_DB01238 Q01959 modulator Sodium-dependent dopamine transporter Ki(nM) = 3220.0
35 P35348_DB01238 P35348 antagonist Alpha-1A adrenergic receptor Ki(nM) = 8.9
IC50(nM) = 170.0
36 P46098_DB01238 P46098 antagonist 5-hydroxytryptamine receptor 3A
37 Q9H3N8_DB01238 Q9H3N8 ligand Histamine H4 receptor Ki(nM) = 10000.0