DB01254 Dasatinib

InChI Key: ZBNZXTGUTAYRHI-UHFFFAOYSA-N
SMILES: CC1=NC(NC2=NC=C(S2)C(=O)NC2=C(C)C=CC=C2Cl)=CC(=N1)N1CCN(CCO)CC1
Small molecule PDB accession : 1N1

List of proteins that are targets for DB01254
# DrugDomain Data UniProt Accession Drug action Protein name Affinity data
1 P09769_DB01254 P09769 n/a Tyrosine-protein kinase Fgr IC50(nM) = 10.0
Kd(nM) = 0.5
2 P51692_DB01254 P51692 inhibitor Signal transducer and activator of transcription 5B
3 Q9NYL2_DB01254 Q9NYL2 n/a Mitogen-activated protein kinase kinase kinase 20 Kd(nM) = 45.0
4 P11142_DB01254 P11142 n/a Heat shock cognate 71 kDa protein
5 P54756_DB01254 P54756 n/a Ephrin type-A receptor 5 Kd(nM) = 0.24
6 P07947_DB01254 P07947 inhibitor Tyrosine-protein kinase Yes IC50(nM) = 0.5
Kd(nM) = 0.3
7 P42684_DB01254 P42684 multitarget Tyrosine-protein kinase ABL2 IC50(nM) = 2100.0
Kd(nM) = 0.17
8 P54760_DB01254 P54760 n/a Ephrin type-B receptor 4 Kd(nM) = 0.34
9 P07948_DB01254 P07948 n/a Tyrosine-protein kinase Lyn IC50(nM) = 1.2
Kd(nM) = 0.57
10 P10721_DB01254 P10721 antagonist Mast/stem cell growth factor receptor Kit Ki(nM) = 620.0
IC50(nM) = 1.0
Kd(nM) = 0.4
11 P29317_DB01254 P29317 antagonist Ephrin type-A receptor 2 IC50(nM) = 0.8
Kd(nM) = 0.85
12 P11274_DB01254 P11274 n/a Breakpoint cluster region protein
13 P09619_DB01254 P09619 antagonist Platelet-derived growth factor receptor beta IC50(nM) = 28.0
Kd(nM) = 0.63
14 P41240_DB01254 P41240 n/a Tyrosine-protein kinase CSK IC50(nM) = 1.3
Kd(nM) = 1.0
15 P06239_DB01254 P06239 multitarget Tyrosine-protein kinase Lck IC50(nM) = 0.4
Kd(nM) = 0.2
16 Q06187_DB01254 Q06187 inhibitor Tyrosine-protein kinase BTK IC50(nM) = 1.3
Kd(nM) = 1.4
17 P00519_DB01254 P00519 multitarget Tyrosine-protein kinase ABL1 IC50(nM) = 0.138
Kd(nM) = 0.016
EC50(nM) = 0.04
18 Q16539_DB01254 Q16539 n/a Mitogen-activated protein kinase 14 IC50(nM) = 100.0
Kd(nM) = 27.0
EC50(nM) = 470.0
19 P06241_DB01254 P06241 multitarget Tyrosine-protein kinase Fyn IC50(nM) = 0.5
Kd(nM) = 0.79
20 P12931_DB01254 P12931 multitarget Proto-oncogene tyrosine-protein kinase Src Ki(nM) = 0.016
IC50(nM) = 0.21
Kd(nM) = 0.21
21 P42685_DB01254 P42685 n/a Tyrosine-protein kinase FRK IC50(nM) = 10.0
Kd(nM) = 0.31
22 Q06203_DB01254 Q06203 n/a Amidophosphoribosyltransferase
23 Q92570_DB01254 Q92570 n/a Nuclear receptor subfamily 4 group A member 3