DB01254 Dasatinib
InChI Key: ZBNZXTGUTAYRHI-UHFFFAOYSA-N
SMILES: CC1=NC(NC2=NC=C(S2)C(=O)NC2=C(C)C=CC=C2Cl)=CC(=N1)N1CCN(CCO)CC1
Small molecule PDB accession : 1N1
List of proteins that are targets for DB01254
| # | DrugDomain Data | UniProt Accession | Drug action | Protein name | Affinity data |
|---|---|---|---|---|---|
| 1 | P09769_DB01254 | P09769 | n/a | Tyrosine-protein kinase Fgr | IC50(nM) = 10.0 Kd(nM) = 0.5 |
| 2 | P51692_DB01254 | P51692 | inhibitor | Signal transducer and activator of transcription 5B | |
| 3 | Q9NYL2_DB01254 | Q9NYL2 | n/a | Mitogen-activated protein kinase kinase kinase 20 | Kd(nM) = 45.0 |
| 4 | P11142_DB01254 | P11142 | n/a | Heat shock cognate 71 kDa protein | |
| 5 | P54756_DB01254 | P54756 | n/a | Ephrin type-A receptor 5 | Kd(nM) = 0.24 |
| 6 | P07947_DB01254 | P07947 | inhibitor | Tyrosine-protein kinase Yes | IC50(nM) = 0.5 Kd(nM) = 0.3 |
| 7 | P42684_DB01254 | P42684 | multitarget | Tyrosine-protein kinase ABL2 | IC50(nM) = 2100.0 Kd(nM) = 0.17 |
| 8 | P54760_DB01254 | P54760 | n/a | Ephrin type-B receptor 4 | Kd(nM) = 0.34 |
| 9 | P07948_DB01254 | P07948 | n/a | Tyrosine-protein kinase Lyn | IC50(nM) = 1.2 Kd(nM) = 0.57 |
| 10 | P10721_DB01254 | P10721 | antagonist | Mast/stem cell growth factor receptor Kit | Ki(nM) = 620.0 IC50(nM) = 1.0 Kd(nM) = 0.4 |
| 11 | P29317_DB01254 | P29317 | antagonist | Ephrin type-A receptor 2 | IC50(nM) = 0.8 Kd(nM) = 0.85 |
| 12 | P11274_DB01254 | P11274 | n/a | Breakpoint cluster region protein | |
| 13 | P09619_DB01254 | P09619 | antagonist | Platelet-derived growth factor receptor beta | IC50(nM) = 28.0 Kd(nM) = 0.63 |
| 14 | P41240_DB01254 | P41240 | n/a | Tyrosine-protein kinase CSK | IC50(nM) = 1.3 Kd(nM) = 1.0 |
| 15 | P06239_DB01254 | P06239 | multitarget | Tyrosine-protein kinase Lck | IC50(nM) = 0.4 Kd(nM) = 0.2 |
| 16 | Q06187_DB01254 | Q06187 | inhibitor | Tyrosine-protein kinase BTK | IC50(nM) = 1.3 Kd(nM) = 1.4 |
| 17 | P00519_DB01254 | P00519 | multitarget | Tyrosine-protein kinase ABL1 | IC50(nM) = 0.138 Kd(nM) = 0.016 EC50(nM) = 0.04 |
| 18 | Q16539_DB01254 | Q16539 | n/a | Mitogen-activated protein kinase 14 | IC50(nM) = 100.0 Kd(nM) = 27.0 EC50(nM) = 470.0 |
| 19 | P06241_DB01254 | P06241 | multitarget | Tyrosine-protein kinase Fyn | IC50(nM) = 0.5 Kd(nM) = 0.79 |
| 20 | P12931_DB01254 | P12931 | multitarget | Proto-oncogene tyrosine-protein kinase Src | Ki(nM) = 0.016 IC50(nM) = 0.21 Kd(nM) = 0.21 |
| 21 | P42685_DB01254 | P42685 | n/a | Tyrosine-protein kinase FRK | IC50(nM) = 10.0 Kd(nM) = 0.31 |
| 22 | Q06203_DB01254 | Q06203 | n/a | Amidophosphoribosyltransferase | |
| 23 | Q92570_DB01254 | Q92570 | n/a | Nuclear receptor subfamily 4 group A member 3 |