DB01267 Paliperidone
InChI Key: PMXMIIMHBWHSKN-UHFFFAOYSA-N
SMILES: CC1=C(CCN2CCC(CC2)C2=NOC3=C2C=CC(F)=C3)C(=O)N2CCCC(O)C2=N1
Small molecule PDB accession : n/a
List of proteins that are targets for DB01267
# | DrugDomain Data | UniProt Accession | Drug action | Protein name | Affinity data |
---|---|---|---|---|---|
1 | P34969_DB01267 | P34969 | n/a | 5-hydroxytryptamine receptor 7 | |
2 | P28221_DB01267 | P28221 | antagonist | 5-hydroxytryptamine receptor 1D | Ki(nM) = 19.0 |
3 | P08908_DB01267 | P08908 | antagonist | 5-hydroxytryptamine receptor 1A | Ki(nM) = 480.0 EC50(nM) = 10000.0 |
4 | P21728_DB01267 | P21728 | antagonist | D | |
5 | P18825_DB01267 | P18825 | agonist | Alpha-2C adrenergic receptor | Ki(nM) = 11.0 |
6 | P18089_DB01267 | P18089 | antagonist | Alpha-2B adrenergic receptor | Ki(nM) = 9.4 |
7 | P28335_DB01267 | P28335 | antagonist | 5-hydroxytryptamine receptor 2C | Ki(nM) = 48.0 |
8 | P28223_DB01267 | P28223 | antagonist | 5-hydroxytryptamine receptor 2A | Ki(nM) = 0.43 IC50(nM) = 5.2 |
9 | P21917_DB01267 | P21917 | antagonist | D | Ki(nM) = 30.0 |
10 | P14416_DB01267 | P14416 | antagonist | D | Ki(nM) = 1.0 IC50(nM) = 8.3 |
11 | P35367_DB01267 | P35367 | antagonist | Histamine H1 receptor | Ki(nM) = 3.4 |
12 | P35462_DB01267 | P35462 | antagonist | D | Ki(nM) = 0.1 |
13 | P08913_DB01267 | P08913 | antagonist | Alpha-2A adrenergic receptor | Ki(nM) = 30.0 |
14 | P35368_DB01267 | P35368 | antagonist | Alpha-1B adrenergic receptor | |
15 | P35348_DB01267 | P35348 | antagonist | Alpha-1A adrenergic receptor | Ki(nM) = 10.1 |