DB01388 Mibefradil
InChI Key: HBNPJJILLOYFJU-VMPREFPWSA-N
SMILES: COCC(=O)O[C@]1(CCN(C)CCCC2=NC3=CC=CC=C3N2)CCC2=C(C=CC(F)=C2)[C@@H]1C(C)C
Small molecule PDB accession : MWV
List of proteins that are targets for DB01388
| # | DrugDomain Data | UniProt Accession | Drug action | Protein name | Affinity data |
|---|---|---|---|---|---|
| 1 | Q9P0X4_DB01388 | Q9P0X4 | inhibitor | Voltage-dependent T-type calcium channel subunit alpha-1I | IC50(nM) = 126.0 |
| 2 | Q02641_DB01388 | Q02641 | inhibitor | Voltage-dependent L-type calcium channel subunit beta-1 | |
| 3 | P54284_DB01388 | P54284 | inhibitor | Voltage-dependent L-type calcium channel subunit beta-3 | |
| 4 | O43497_DB01388 | O43497 | inhibitor | Voltage-dependent T-type calcium channel subunit alpha-1G | IC50(nM) = 64.0 |
| 5 | Q01668_DB01388 | Q01668 | inhibitor | Voltage-dependent L-type calcium channel subunit alpha-1D | |
| 6 | Q13698_DB01388 | Q13698 | inhibitor | Voltage-dependent L-type calcium channel subunit alpha-1S | |
| 7 | O00305_DB01388 | O00305 | inhibitor | Voltage-dependent L-type calcium channel subunit beta-4 | |
| 8 | Q13936_DB01388 | Q13936 | inhibitor | Voltage-dependent L-type calcium channel subunit alpha-1C | IC50(nM) = 156.0 |
| 9 | O95180_DB01388 | O95180 | inhibitor | Voltage-dependent T-type calcium channel subunit alpha-1H | IC50(nM) = 32.0 |
| 10 | Q08289_DB01388 | Q08289 | inhibitor | Voltage-dependent L-type calcium channel subunit beta-2 | |
| 11 | O60840_DB01388 | O60840 | inhibitor | Voltage-dependent L-type calcium channel subunit alpha-1F |