DB01392 Yohimbine

InChI Key: BLGXFZZNTVWLAY-SCYLSFHTSA-N
SMILES: [H][C@@]12CC[C@H](O)[C@H](C(=O)OC)[C@@]1([H])C[C@]1([H])N(CCC3=C1NC1=CC=CC=C31)C2
Small molecule PDB accession : n/a

List of proteins that are targets for DB01392
# DrugDomain Data UniProt Accession Drug action Protein name Affinity data
1 P28221_DB01392 P28221 partial agonist 5-hydroxytryptamine receptor 1D Ki(nM) = 15.84
2 P08908_DB01392 P08908 partial agonist 5-hydroxytryptamine receptor 1A Ki(nM) = 50.11
3 P18825_DB01392 P18825 antagonist Alpha-2C adrenergic receptor Ki(nM) = 0.13
IC50(nM) = 27.1
4 P18089_DB01392 P18089 antagonist Alpha-2B adrenergic receptor Ki(nM) = 0.32
5 P28335_DB01392 P28335 antagonist 5-hydroxytryptamine receptor 2C Ki(nM) = 645.65
6 P28223_DB01392 P28223 antagonist 5-hydroxytryptamine receptor 2A Ki(nM) = 252.0
7 P14416_DB01392 P14416 antagonist D Ki(nM) = 280.0
8 P41595_DB01392 P41595 antagonist 5-hydroxytryptamine receptor 2B Ki(nM) = 4.12
9 P28222_DB01392 P28222 partial agonist 5-hydroxytryptamine receptor 1B Ki(nM) = 5.0
10 P35462_DB01392 P35462 antagonist D Ki(nM) = 2489.0
11 P08913_DB01392 P08913 antagonist Alpha-2A adrenergic receptor Ki(nM) = 0.32
IC50(nM) = 3.67
Kd(nM) = 2300.0
EC50(nM) = 8.5