DB01392 Yohimbine
InChI Key: BLGXFZZNTVWLAY-SCYLSFHTSA-N
SMILES: [H][C@@]12CC[C@H](O)[C@H](C(=O)OC)[C@@]1([H])C[C@]1([H])N(CCC3=C1NC1=CC=CC=C31)C2
Small molecule PDB accession : n/a
List of proteins that are targets for DB01392
| # | DrugDomain Data | UniProt Accession | Drug action | Protein name | Affinity data |
|---|---|---|---|---|---|
| 1 | P28221_DB01392 | P28221 | partial agonist | 5-hydroxytryptamine receptor 1D | Ki(nM) = 15.84 |
| 2 | P08908_DB01392 | P08908 | partial agonist | 5-hydroxytryptamine receptor 1A | Ki(nM) = 50.11 |
| 3 | P18825_DB01392 | P18825 | antagonist | Alpha-2C adrenergic receptor | Ki(nM) = 0.13 IC50(nM) = 27.1 |
| 4 | P18089_DB01392 | P18089 | antagonist | Alpha-2B adrenergic receptor | Ki(nM) = 0.32 |
| 5 | P28335_DB01392 | P28335 | antagonist | 5-hydroxytryptamine receptor 2C | Ki(nM) = 645.65 |
| 6 | P28223_DB01392 | P28223 | antagonist | 5-hydroxytryptamine receptor 2A | Ki(nM) = 252.0 |
| 7 | P14416_DB01392 | P14416 | antagonist | D | Ki(nM) = 280.0 |
| 8 | P41595_DB01392 | P41595 | antagonist | 5-hydroxytryptamine receptor 2B | Ki(nM) = 4.12 |
| 9 | P28222_DB01392 | P28222 | partial agonist | 5-hydroxytryptamine receptor 1B | Ki(nM) = 5.0 |
| 10 | P35462_DB01392 | P35462 | antagonist | D | Ki(nM) = 2489.0 |
| 11 | P08913_DB01392 | P08913 | antagonist | Alpha-2A adrenergic receptor | Ki(nM) = 0.32 IC50(nM) = 3.67 Kd(nM) = 2300.0 EC50(nM) = 8.5 |