DB01567 Fludiazepam
InChI Key: ROYOYTLGDLIGBX-UHFFFAOYSA-N
SMILES: CN1C2=C(C=C(Cl)C=C2)C(=NCC1=O)C1=CC=CC=C1F
Small molecule PDB accession : n/a
List of proteins that are targets for DB01567
| # | DrugDomain Data | UniProt Accession | Drug action | Protein name | Affinity data |
|---|---|---|---|---|---|
| 1 | O14764_DB01567 | O14764 | potentiator | Gamma-aminobutyric acid receptor subunit delta | |
| 2 | P47870_DB01567 | P47870 | potentiator | Gamma-aminobutyric acid receptor subunit beta-2 | |
| 3 | P18507_DB01567 | P18507 | potentiator | Gamma-aminobutyric acid receptor subunit gamma-2 | |
| 4 | P14867_DB01567 | P14867 | potentiator | Gamma-aminobutyric acid receptor subunit alpha-1 | |
| 5 | P31644_DB01567 | P31644 | potentiator | Gamma-aminobutyric acid receptor subunit alpha-5 | |
| 6 | P28472_DB01567 | P28472 | potentiator | Gamma-aminobutyric acid receptor subunit beta-3 | |
| 7 | P47869_DB01567 | P47869 | potentiator | Gamma-aminobutyric acid receptor subunit alpha-2 | |
| 8 | P34903_DB01567 | P34903 | potentiator | Gamma-aminobutyric acid receptor subunit alpha-3 | |
| 9 | Q8N1C3_DB01567 | Q8N1C3 | potentiator | Gamma-aminobutyric acid receptor subunit gamma-1 | |
| 10 | Q99928_DB01567 | Q99928 | potentiator | Gamma-aminobutyric acid receptor subunit gamma-3 | |
| 11 | O00591_DB01567 | O00591 | potentiator | Gamma-aminobutyric acid receptor subunit pi | |
| 12 | P18505_DB01567 | P18505 | potentiator | Gamma-aminobutyric acid receptor subunit beta-1 | |
| 13 | P78334_DB01567 | P78334 | potentiator | Gamma-aminobutyric acid receptor subunit epsilon | |
| 14 | A8MPY1_DB01567 | A8MPY1 | potentiator | Gamma-aminobutyric acid receptor subunit rho-3 | |
| 15 | P28476_DB01567 | P28476 | potentiator | Gamma-aminobutyric acid receptor subunit rho-2 | |
| 16 | P24046_DB01567 | P24046 | potentiator | Gamma-aminobutyric acid receptor subunit rho-1 |